Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0016 |
| Product Name | Ectoin |
| CAS | 96702-03-3 |
| Structure |  |
| Synonyms | (4S)-2-Methyl-1,4,5,6-Tetrahydropyrimidine-4-Carboxylic Acid, Ectoine |
| IUPAC Name | (6S)-2-methyl-1,4,5,6-tetrahydropyrimidine-6-carboxylic acid |
| Molecular Weight | 142.16 g/mol |
| Molecular Formula | C6H10N2O2 |
| InChI | InChI=1S/C6H10N2O2/c1-4-7-3-2-5(8-4)6(9)10/h5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChI Key | WQXNXVUDBPYKBA-YFKPBYRVSA-N |
| Boiling Point | 381.5±35.0 °C |
| Melting Point | 280 °C |
| Purity | 95% |
| Density | 1.37 g/mL |
| Appearance | White Or Off-white Powder |
| Application | Because it is mild, has good moisturizing properties and no greasy feeling, it can be added to various skin care products, such as toner, sunscreen, cream, mask liquid, spray, repair liquid, lotion, etc. |
| Storage | The product may be stored for 24 months from the date of manufture in the unopened original container and at room temperature. It should be protected from light, heat, oxygen and moisture. Keep container tightly closed. Once opened, use contents quickly. |
| Advantage | High efficiency ; Good skin feeling ; Low irritation ; High safety |
| EC Number | 431-910-1 |
| Highest Usage In Residency Products | 0.07 |
| INCI | Ectoin |
| Isomeric SMILES | CC1=NCC[C@H](N1)C(=O)O |
| Loss On Drying | ≤1.0% |
| Normal Dosage | 0.3-2.0%Tag: Anti Aging Antioxidants , Age Defying Antioxidants , Anti Aging Free Radical Fighters |
| pKa | 3.14±0.20 |
Ectoin, a natural cell protection factor derived from halophilic bacteria such as Ectothiorhodospira halochloris, is utilized for its remarkable ability to safeguard and stabilize cell structures under extreme environmental conditions. These bacteria thrive in challenging habitats like saltwater, seas, and saline deserts, where they endure high UV irradiation, dryness, extreme temperatures, and salinity. Ectoin's protective properties enable it to enhance the skin's moisture-binding capacity, exert a moisturizing and anti-inflammatory effect, and bolster cell membrane stability. Consequently, it provides increased protection against harsh environmental stressors, such as extreme temperatures and UV radiation. Additionally, Ectoin promotes the maintenance of skin cells and immune function, offering significant UVA protection. Its efficacy is evidenced by in-vivo studies that demonstrate improvements in the tactile qualities of skincare products, making it one of the most effective natural choices for enhancing skin cell protection.
What is Ectoin, and where is it found?
Ectoin is a natural cell protection factor discovered in halophilic bacteria, such as Ectothiorhodospira halochloris. These bacteria thrive in extreme conditions, including saltwater, sea environments, and saline deserts. Ectoin is an amino acid that helps these microorganisms survive under high UV irradiation, dryness, extreme temperatures, and high salinity.
How does Ectoin benefit the skin?
Ectoin supports the skin's moisture-binding capacity and has moisturizing and anti-inflammatory effects. It stabilizes cell structures by protecting cell membranes, resulting in enhanced cell protection against extreme environmental factors, such as high or low temperatures, high salt concentration, dehydration, and UV radiation. Additionally, Ectoin is known to stimulate skin cells' protective properties, aiding in cell and immune system maintenance and offering UVA protection.
Can Ectoin improve the effectiveness of skincare products?
Yes, Ectoin can improve the tactile properties of skincare products. Based on an in-vivo study, incorporating Ectoin enhances the product experience by improving its texture and application on the skin, which can contribute to more effective skincare routines.
What makes Ectoin a unique ingredient for cell protection?
Ectoin is unique due to its ability to stabilize the biopolymers of cells, allowing them to withstand damaging external stress factors such as extreme temperatures and high salinity. Unlike other substances, Ectoin naturally enhances cell protection and resilience, making it a valuable ingredient in products designed to protect and nurture skin under stressful environmental conditions.
If you have any questions, please contact us. You will get a satisfactory answer.
