Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-GU-0059 |
Product Name | Dodecyl Gallate |
CAS | 1166-52-5 |
Structure | |
Synonyms | Dodecyl 3,4,5-trihydroxybenzoate, Lauryl gallate, Nipagallin LA |
IUPAC Name | dodecyl 3,4,5-trihydroxybenzoate |
Molecular Weight | 338.4 g/mol |
Molecular Formula | C19H30O5 |
InChI | InChI=1S/C19H30O5/c1-2-3-4-5-6-7-8-9-10-11-12-24-19(23)15-13-16(20)18(22)17(21)14-15/h13-14,20-22H,2-12H2,1H3 |
InChI Key | RPWFJAMTCNSJKK-UHFFFAOYSA-N |
Boiling Point | 394.5 °C |
Melting Point | 94-97 °C |
Purity | 95% |
Density | 1.07 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.0003 |
Isomeric SMILES | CCCCCCCCCCCCOC(=O)C1=CC(=C(C(=C1)O)O)O |
pKa | 7.93±0.25 |
What is the chemical formula for Dodecyl Gallate?
The chemical formula for Dodecyl Gallate is C19H30O5.
What is the molecular weight of Dodecyl Gallate?
The molecular weight of Dodecyl Gallate is 338.44 g/mol.
What is the melting point of Dodecyl Gallate?
The melting point of Dodecyl Gallate is 94-97 °C.
What is the solubility of Dodecyl Gallate in water?
Dodecyl Gallate is practically insoluble in water.
What is the main use of Dodecyl Gallate in the food industry?
Dodecyl Gallate is used as an antioxidant in foods like cream cheese, margarine, fats, and oils to prevent oxidation of unsaturated fatty acids.
What safety code is associated with Dodecyl Gallate?
Dodecyl Gallate is associated with hazard code Xi.
How is Dodecyl Gallate commonly used in the pharmaceutical industry?
Dodecyl Gallate is used as an antioxidant in cosmetic and pharmaceutical creams and emulsions, various fats, oils, waxes, and foods.
What is the color and odor of Dodecyl Gallate?
Dodecyl Gallate is white to almost white in color and odorless.
What is the refractive index of Dodecyl Gallate?
The estimated refractive index of Dodecyl Gallate is 1.6120.
What is the toxicity of Dodecyl Gallate when orally administered to rabbits?
The LD50 orally in rabbits for Dodecyl Gallate is 5000 mg/kg.