Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1247 |
| Product Name | Dimethyl Adipate |
| CAS | 627-93-0 |
| Structure |  |
| Synonyms | Adipic acid, dimethyl ester;Dimethyl hexanedioate;Hexanedioic acid, dimethyl ester |
| IUPAC Name | dimethyl hexanedioate |
| Molecular Weight | 174.19 g/mol |
| Molecular Formula | C8H14O4 |
| InChI | InChI=1S/C8H14O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H2,1-2H3 |
| InChI Key | UDSFAEKRVUSQDD-UHFFFAOYSA-N |
| Boiling Point | 109-110 °C / 14mmHg |
| Melting Point | 8 °C |
| Purity | 95% |
| Density | 1.06 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.04 |
| Highest Usage In Rinsing Products | 0.239 |
| Isomeric SMILES | COC(=O)CCCCC(=O)OC |
What is the chemical formula for Dimethyl adipate?
The chemical formula for Dimethyl adipate is C8H14O4.
What is the boiling point of Dimethyl adipate?
The boiling point of Dimethyl adipate is 109-110 °C/14 mmHg.
What are the safety statements associated with Dimethyl adipate?
The safety statements associated with Dimethyl adipate are 24/25.
How is Dimethyl adipate synthesized?
Dimethyl adipate is synthesized by the esterification of adipic acid and methanol in the presence of an acid catalyst.
What is the odor type of Dimethyl adipate?
The odor type of Dimethyl adipate is nutty.
How is Dimethyl adipate used in the cosmetic industry?
Dimethyl adipate is used in cosmetics as an emollient and for skin conditioning.
What are some of the reactions Dimethyl adipate can undergo?
Dimethyl adipate can react with acids, alkalis, and strong oxidants.
What are some of the risks associated with exposure to Dimethyl adipate?
Exposure to Dimethyl adipate can cause harmful effects through inhalation, ingestion, or skin absorption.
How is Dimethyl adipate produced on an industrial scale?
Dimethyl adipate is produced through the immobilized Candida antarctica lipase B-catalyzed esterification of adipic acid and methanol.
What precautions should be taken when handling Dimethyl adipate?
When handling Dimethyl adipate, occupational workers should use self-contained breathing apparatus, rubber boots, and heavy rubber gloves to avoid prolonged exposure. They should also avoid contact with skin, eyes, and nose.
If you have any questions, please contact us. You will get a satisfactory answer.
