Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0160 |
| Product Name | Diethylamino Hydroxybenzoyl Hexyl Benzoate |
| CAS | 302776-68-7 |
| Structure |  |
| Synonyms | Hexyl 2-(4-(diethylamino)-2-hydroxybenzoyl)benzoate;Benzoic acid, 2-(4-(diethylamino)-2-hydroxybenzoyl)-, hexyl ester |
| IUPAC Name | hexyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate |
| Molecular Weight | 397.51 g/mol |
| Molecular Formula | C24H31NO4 |
| InChI | InChI=1S/C24H31NO4/c1-4-7-8-11-16-29-24(28)20-13-10-9-12-19(20)23(27)21-15-14-18(17-22(21)26)25(5-2)6-3/h9-10,12-15,17,26H,4-8,11,16H2,1-3H3 |
| InChI Key | FDATWRLUYRHCJE-UHFFFAOYSA-N |
| Boiling Point | 524.8±40.0 °C |
| Purity | 95% |
| Density | 1.11 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCCCCCOC(=O)C1=CC=CC=C1C(=O)C2=C(C=C(C=C2)N(CC)CC)O |
| pKa | 7.57±0.35 |
What is the chemical formula of Diethylamino hydroxybenzoyl hexyl benzoate?
The chemical formula of Diethylamino hydroxybenzoyl hexyl benzoate is C24H31NO4.
What is the molecular weight of Diethylamino hydroxybenzoyl hexyl benzoate?
The molecular weight of Diethylamino hydroxybenzoyl hexyl benzoate is 397.51 g/mol.
What is the boiling point of Diethylamino hydroxybenzoyl hexyl benzoate?
The predicted boiling point of Diethylamino hydroxybenzoyl hexyl benzoate is 524.8±40.0°C.
What are the synonyms for Diethylamino hydroxybenzoyl hexyl benzoate?
Some synonyms for Diethylamino hydroxybenzoyl hexyl benzoate include UV absorber A PLUS, UVAPlus/DHHB, UVA PLUS, and more.
How is Diethylamino hydroxybenzoyl hexyl benzoate used in cosmetic products?
Diethylamino hydroxybenzoyl hexyl benzoate is used as a UV filter in cosmetics to protect the skin from harmful UV-A radiation.
Where is Diethylamino hydroxybenzoyl hexyl benzoate marketed?
Diethylamino hydroxybenzoyl hexyl benzoate is marketed in Europe, the U.S., South America, Mexico, Japan, and Taiwan.
What is the water solubility of Diethylamino hydroxybenzoyl hexyl benzoate?
The water solubility of Diethylamino hydroxybenzoyl hexyl benzoate is 16μg/L at 20℃.
What is the safety information associated with Diethylamino hydroxybenzoyl hexyl benzoate?
Diethylamino hydroxybenzoyl hexyl benzoate has a risk statement of 53 and safety statement of 61, with a WGK Germany rating of 1.
How is Diethylamino hydroxybenzoyl hexyl benzoate synthesized?
Diethylamino hydroxybenzoyl hexyl benzoate can be synthesized by exposing a solution of the compound to UV-B radiation in a photoreactor.
What is the absorbance peak wavelength of Diethylamino hydroxybenzoyl hexyl benzoate for UV-A radiation?
Diethylamino hydroxybenzoyl hexyl benzoate absorbs UV-A radiation with a peak at 354 nm.
If you have any questions, please contact us. You will get a satisfactory answer.
