Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Dibutyl Adipate

Online Inquiry

Catalog Number	CI-SC-1219
Product Name	Dibutyl Adipate
CAS	105-99-7
Structure
Synonyms	Adipic acid, dibutyl ester;Hexanedioic acid, 1,6-dibutyl ester;Hexanedioic acid, dibutyl ester;Di-n-butyl adipate
IUPAC Name	dibutyl hexanedioate
Molecular Weight	258.35 g/mol
Molecular Formula	C14H26O4
InChI	InChI=1S/C14H26O4/c1-3-5-11-17-13(15)9-7-8-10-14(16)18-12-6-4-2/h3-12H2,1-2H3
InChI Key	XTJFFFGAUHQWII-UHFFFAOYSA-N
Boiling Point	305 °C
Melting Point	-32 °C
Purity	95%
Density	0.96 g/mL
Appearance	Liquid
Highest Usage In Residency Products	0.15
Isomeric SMILES	CCCCOC(=O)CCCCC(=O)OCCCC

Custom Q&A

What is the chemical formula of Dibutyl adipate?

The chemical formula of Dibutyl adipate is C14H26O4.

What is the molecular weight of Dibutyl adipate?

The molecular weight of Dibutyl adipate is 258.35 g/mol.

What are some synonyms of Dibutyl adipate?

Some synonyms of Dibutyl adipate include di-n-butyladipate, dlbutyladipate, and ADIPIC ACID DI-N-BUTYL ESTER.

What is the melting point of Dibutyl adipate?

The melting point of Dibutyl adipate is -32 °C.

How is Dibutyl adipate commonly used in cosmetic formulations?

Dibutyl adipate is used in cosmetic formulations as a plasticizer, a skin-conditioning agent, and a solvent.

Is Dibutyl adipate soluble in water?

Dibutyl adipate is insoluble in water.

What are some safety statements associated with Dibutyl adipate?

Safety statements associated with Dibutyl adipate include 26-36/37/39-24/25, which indicate precautions for handling and storage.

What is the storage temperature recommendation for Dibutyl adipate?

Dibutyl adipate should be sealed in dry, room temperature storage.

Is Dibutyl adipate flammable?

Dibutyl adipate is non-flammable.

How does Dibutyl adipate behave when heated to decomposition?

When heated to decomposition, Dibutyl adipate emits acrid smoke and irritating fumes.

Online Inquiry