Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0048 |
| Product Name | Dextrin |
| CAS | 9004-53-9 |
| Synonyms | Corndextrin |
| IUPAC Name | (3R,4S,5S,6R)-2-[(2R,3S,4R,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight | 504.44 g/mol |
| Molecular Formula | C18H32O16 |
| InChI | InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17?,18?/m1/s1 |
| InChI Key | FYGDTMLNYKFZSV-MRCIVHHJSA-N |
| Melting Point | 54 °C |
| Density | 0.8 g/mL |
| Appearance | White to off-white powder |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2O)O)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)O)O)CO)CO)O)O)O)O |
Dextrin, a partially hydrolyzed starch polysaccharide, is utilized in various cosmetic applications, particularly excelling in soap bar production. It appears as a white-to-tan powder, offering several benefits in the manufacturing process. By enhancing the structure and hardness of the bars, Dextrin facilitates a smoother release from molds post-extrusion by reducing stickiness. This not only contributes to enhanced manufacturing efficiency but also serves as a cost-effective filler option for other personal care products.
What is Dextrin and how is it produced?
Dextrin is a degraded starch polysaccharide derived from the partial hydrolysis of amylose and amylopectin, the components of the original starch. This process involves breaking down the 1,4a D and 1,6a D linkages, resulting in a white-to-tan powder.
What are the primary uses of Dextrin in cosmetic and personal care applications?
In the cosmetics industry, Dextrin is primarily used in powder applications. It is particularly effective in the processing of soap bars, where it aids in structuring and hardening the bar. Additionally, Dextrin is used to reduce tackiness, allowing the bars to be easily released from molds after extrusion. It also serves as a cost-effective filler in various personal care products.
How does Dextrin enhance soap bar manufacturing?
Dextrin enhances soap bar manufacturing by improving the physical properties of the soap. It contributes to the structural integrity and hardness of the bar, minimizes stickiness, and facilitates easy release from extrusion molds. This not only improves the overall efficiency of the production process but also results in high-quality soap bars.
Why is Dextrin considered a cost-effective option in personal care products?
Dextrin is regarded as cost-effective due to its dual functionality as both a filler and a performance enhancer. It helps lower the cost of formulations by replacing more expensive ingredients without compromising on the quality or effectiveness of the final product.
What are the physical characteristics of Dextrin that make it suitable for these applications?
The physical characteristics of Dextrin include its powder form and its color range from white to tan. These properties make it an ideal ingredient for cosmetic applications, where a fine powder is necessary, and for soap manufacturing, where consistency and structural integrity are key.
If you have any questions, please contact us. You will get a satisfactory answer.
