Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1296 |
| Product Name | Creatine |
| CAS | 57-00-1 |
| Structure |  |
| Synonyms | Glycine, N-(aminoiminomethyl)-N-methyl-;N-Amidinosarcosine |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid |
| Molecular Weight | 131.13 g/mol |
| Molecular Formula | C4H9N3O2 |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| InChI Key | CVSVTCORWBXHQV-UHFFFAOYSA-N |
| Boiling Point | 242.5 °C |
| Melting Point | 295 °C |
| Purity | 95% |
| Density | 1.33 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.015 |
| Highest Usage In Rinsing Products | 0.015 |
| Isomeric SMILES | CN(CC(=O)O)C(=N)N |
| pKa | 2.63 |
If you have any questions, please contact us. You will get a satisfactory answer.
