Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1296 |
| Product Name | Creatine |
| CAS | 57-00-1 |
| Structure |  |
| Synonyms | Glycine, N-(aminoiminomethyl)-N-methyl-;N-Amidinosarcosine |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid |
| Molecular Weight | 131.13 g/mol |
| Molecular Formula | C4H9N3O2 |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| InChI Key | CVSVTCORWBXHQV-UHFFFAOYSA-N |
| Boiling Point | 242.5 °C |
| Melting Point | 295 °C |
| Purity | 95% |
| Density | 1.33 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.015 |
| Highest Usage In Rinsing Products | 0.015 |
| Isomeric SMILES | CN(CC(=O)O)C(=N)N |
| pKa | 2.63 |
Creatine is a derivative of amino acids, specifically glycine and arginine, and is naturally present in the skin. It plays a vital role as an energy reserve, crucial for cellular energy supply and function. By participating in the production of ATP, a universal energy molecule, creatine serves as an intracellular energy accumulator, effectively recharging and providing energy as needed, thereby enhancing the cellular energy system. As individuals age, the body's production of creatine diminishes, making the external application to the skin beneficial for energizing and boosting metabolism. In addition to its energizing qualities, creatine also soothes and moisturizes the skin, highlighting its valuable properties as an active ingredient.
What is creatine, and how does it benefit the skin?
Creatine is an amino acid derivative, specifically a non-proteinogenic amino acid known as Methylguanidoacetic acid. It is naturally found in the skin and plays a crucial role as an energy reservoir essential for the energy supply and cellular function. Creatine participates in ATP production, acting like an intracellular accumulator, providing on-demand fuel to improve the cells' energy system. Apart from energizing the skin, creatine also soothes and moisturizes, offering excellent care properties as an active ingredient.
Why should creatine be applied externally to the skin?
Although the body naturally produces creatine from the amino acids glycine and arginine, the production of methylguanidoacetic acid declines with age. To counteract this decrease, it is beneficial to administer creatine externally to the skin. Doing so helps energize the skin, boost its metabolism, and maintain its youthful vitality.
How does creatine contribute to skin metabolism enhancement?
Creatine acts as a vital energy source for skin cells by participating in ATP production, a universal fuel molecule. By providing fuel on demand and improving the skin cells' energy system, creatine enhances the skin's metabolism. This metabolic boost can lead to better skin vitality and health, demonstrating creatine's efficacy as an active skincare ingredient.
Can creatine have a soothing effect on the skin?
Yes, creatine has a soothing effect on the skin. In addition to its energizing properties, creatine helps to moisturize and calm the skin, making it an excellent component for skin care products aimed at providing comfort and hydration alongside energy and vitality.
If you have any questions, please contact us. You will get a satisfactory answer.
