Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0199 |
| Product Name | Climbazole |
| CAS | 38083-17-9 |
| Structure |  |
| Synonyms | 1-(4-Chloro-phenoxy)-1-(2,5-dihydro-imidazole-1-yl)-3,3-dimethyl-butan-2-one |
| IUPAC Name | 1-(4-chlorophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
| Molecular Weight | 292.76 g/mol |
| Molecular Formula | C15H17ClN2O2 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(2,3)13(19)14(18-9-8-17-10-18)20-12-6-4-11(16)5-7-12/h4-10,14H,1-3H3 |
| InChI Key | OWEGWHBOCFMBLP-UHFFFAOYSA-N |
| Boiling Point | 447.5±40.0 °C |
| Melting Point | 96-100 °C |
| Purity | 95% |
| Density | 1.17 g/mL |
| Solubility | Insoluble in water |
| Appearance | Solid |
| Isomeric SMILES | CC(C)(C)C(=O)C(N1C=CN=C1)OC2=CC=C(C=C2)Cl |
| pKa | 5.66±0.22 |
What is the chemical formula of Climbazole?
The chemical formula of Climbazole is C15H17ClN2O2.
What is the boiling point of Climbazole?
The boiling point of Climbazole is predicted to be 447.5±40.0 °C.
What is the water solubility of Climbazole?
The water solubility of Climbazole is 58mg/L at 25℃.
What are some synonyms for Climbazole?
Some synonyms for Climbazole include BAY MEB-6401, Diadimefon, and Crinipan AD.
How does Climbazole affect aquatic organisms in the environment?
Climbazole is considered an emerging recalcitrant contaminant in wastewater, with severe toxic effects on aquatic organisms.
How does Climbazole inhibit the growth of certain organisms?
Climbazole works as an imidazole antifungal agent by inhibiting the growth of organisms like C. albicans, M. pachydermatis, and M. furfur.
What are the hazards associated with Climbazole?
Climbazole is classified as moderately toxic by ingestion and low toxicity by skin contact, and it may cause localized irritation of the skin.
In what products is Climbazole commonly used?
Climbazole is commonly used in shampoos for its anti-dandruff benefits.
What are the safety statements associated with Climbazole?
The safety statements associated with Climbazole are 60-61.
How does Climbazole affect the skin of dogs when used in a certain dose?
Climbazole has been shown to reduce the size of Malassezia populations on the skin of naturally infected dogs when used at a dose of 2% in shampoo.
If you have any questions, please contact us. You will get a satisfactory answer.
