Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0362 |
| Product Name | Citronella Oil |
| CAS | 8000-29-1 |
| Synonyms | Cymbopogon winterianus |
| Description | Citronella oil is obtained by the steam distillation of the freshly cut or partially dried grasses of Cymbopogon winterianus (Lemongrass). Citronella oil is often used as an insect repellent, but is also useful in soaps, perfumes, aromatherapy, cosmetics and candle making. |
| IUPAC Name | 3,7-Dimethyloct-6-enal |
| Molecular Formula | CAS: 8000-29-1 |
| Canonical SMILES | CC(CCC=C(C)C)CC=O |
| InChI | NEHNMFOYXAPHSD-UHFFFAOYSA-N |
| InChI Key | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| Boiling Point | 222 °C |
| Flash Point | 195 °F |
| Purity | 96% |
| Density | 0.897 g/mL at 25 °C(lit.) |
| Solubility | Oil-Soluble |
| Appearance | Pale yellow liquid, fresh lemon-like scent |
| Application | Insect repellent products, creams, lotions, ointments, bath oils, soaps, cleansers. |
| Storage | Store light-protected at a cool and dry place |
| Composition | Cymbopogon Winterianus (citronella) oil |
| Features And Benefits | Widely used in aromatherapy and as insect repellentProvides a typical citrus note in fragrancesHas some anti-microbial effects and can therefore be used cleansing products |
| GMO | GMONo data available, but unlikely to contain s |
| HS Code | 1518009000 |
| INCI | Cymbopogon Winterianus (citronella) oil |
| Manufacture | Obtained by steam distillation of the freshly cut or partially dried grasses of Cymbopogon winterianus. This is known as the "Java" type of citronella essential oil. |
| Preservation | Preservative-free |
| Purity Grade | No purity grade applicable |
| Raw Material Source | Dried grasses of Cymbopogon winterianus |
| Refractive Index | n20/D 1.471(lit.) |
| Uses | Can be added to formulas as is, add to the oil phase or at the end of the formulating process. Use level 1-5%. |
Citronella oil, known for its lemony and uplifting aroma, is primarily derived from the Cymbopogon Nardus plant through steam distillation. This versatile essential oil has a range of applications due to its properties as an antiseptic, antispasmodic, deodorant, diaphoretic, and fungicidal agent. It also serves as a bactericidal, diuretic, emmenagogue, febrifuge, insecticide, stomachic, tonic, and vermifuge. Historically used in various cultures for its aromatic qualities and medicinal benefits, it addresses issues such as fever, digestive and menstrual problems, excessive sweating, and minor infections. Notably, citronella oil is renowned for its effectiveness as an insect repellent, often blended with cedarwood oil for enhanced protection against mosquitoes before the widespread use of synthetic insecticides. Additionally, it mixes well with other essential oils like sandalwood, patchouli, geranium, and lemon. As with many essential oils, citronella oil may cause allergic reactions or dermatitis in some individuals and should be avoided during pregnancy.
What is citronella essential oil made from?
Citronella essential oil is made from the leaves and stems of plants in the Cymbopogon genus.
What are some common uses of citronella essential oil?
Citronella essential oil is commonly used in perfumes, soaps, candles, and insect repellents.
What are the antiseptic and antibacterial properties of citronella essential oil?
Citronella essential oil has antiseptic and antibacterial properties that can help prevent infections and reduce inflammation, making it beneficial for those with acne-prone skin.
How does citronella essential oil repel insects?
Citronella essential oil has bug-repelling qualities, particularly against mosquitoes, making it useful in natural insect repellents.
How does citronella essential oil benefit those with oily or mixed skin?
Citronella essential oil has astringent properties that can help tighten the skin, minimize the visibility of pores, and regulate oil production in those with oily or mixed skin.
What soothing effects does citronella essential oil have on the skin?
Citronella essential oil has a soothing and calming effect on the skin, reducing redness and irritation. It is frequently used in skincare products for delicate skin.
How does citronella essential oil promote healthy hair?
Citronella essential oil can enhance the growth of healthy hair by boosting hair follicles, minimizing dandruff, stimulating hair growth, and adding shine to dull hair.
How should citronella essential oil be used on the skin or hair?
Citronella essential oil should be diluted with a carrier oil and used sparingly. It is recommended to perform a patch test before using it on the skin or hair.
How can citronella essential oil be used for hydration and acne treatment?
Citronella essential oil can be mixed with regular moisturizer or facial oil for hydration and used with carrier oils for acne treatment on acne-prone areas.
How does citronella essential oil help brighten the skin and fight signs of aging?
Citronella essential oil can make dark spots and blemishes less noticeable, tighten pores, balance skin tone, fight aging signs like fine lines and wrinkles, and increase skin radiance by stimulating blood circulation.
If you have any questions, please contact us. You will get a satisfactory answer.
