Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1207 |
Product Name | Cholesteryl Oleyl Carbonate |
CAS | 17110-51-9 |
Structure | ![]() |
Synonyms | Cholest-5-en-3-ol (3beta)-, (9Z)-9-octadecenyl carbonate;Cholest-5-en-3beta-yl (Z)-octadec-9-en-1-yl carbonate |
IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [(Z)-octadec-9-enyl] carbonate |
Molecular Weight | 681.1 g/mol |
Molecular Formula | C46H80O3 |
InChI | InChI=1S/C46H80O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-48-44(47)49-39-30-32-45(5)38(35-39)26-27-40-42-29-28-41(37(4)25-23-24-36(2)3)46(42,6)33-31-43(40)45/h14-15,26,36-37,39-43H,7-13,16-25,27-35H2,1-6H3/b15-14-/t37-,39+,40+,41-,42+,43+,45+,46-/m1/s1 |
InChI Key | XMPIMLRYNVGZIA-TZOMHRFMSA-N |
Boiling Point | 633.5 °C |
Melting Point | 20 °C |
Purity | 95% |
Density | 0.94 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.06 |
Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
What is Cholesteryl Oleyl Carbonate and its primary use?
Cholesteryl Oleyl Carbonate (COC) is a carbonate ester derived from cholesterol and oleyl alcohol combined with carbonic acid. It serves primarily as a liquid crystal (LC) molecule due to its crystalline material properties and helical structure. COC is used in various applications, including biomedical fields and the fabrication of multifunctional switchable devices.
How does Cholesteryl Oleyl Carbonate function as a liquid crystal?
As a liquid crystal, COC exhibits a low degree of molecular order, resulting in anisotropy-or directional differences-in its electrical, magnetic, and optical properties. These properties allow COC to respond to radiant energy by undergoing phase transitions, reflecting specific wavelengths of light based on the crystal array's "pitch length," which varies with temperature.
In what applications can Cholesteryl Oleyl Carbonate be utilized?
COC can be incorporated into polyethylene glycol (PEG)-polyurethane (PU) matrices to enhance haemocompatibility and reduce thrombogenicity, making it useful as a biomaterial in biomedical applications. Additionally, it can self-assemble with cadmium selenide (CdSe) quantum dots for creating novel multifunctional switchable devices.
What are the transition temperatures for Cholesteryl Oleyl Carbonate?
COC transitions from a crystal to an isotropic state at approximately 20°C. It reaches cholesteric-isotropic transition at about 40°C. While it naturally remains in a smectic phase, it may slowly crystallize into a solid over time.
What are some typical applications of liquid crystals like COC?
Liquid crystals, including COC, are commonly used in thermally activated displays, sensors, detection devices, and cosmetics due to their ability to change properties with temperature variance and light reflection capabilities. They are particularly valuable in creating responsive and adaptive material systems.