Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1207 |
| Product Name | Cholesteryl Oleyl Carbonate |
| CAS | 17110-51-9 |
| Structure |  |
| Synonyms | Cholest-5-en-3-ol (3beta)-, (9Z)-9-octadecenyl carbonate;Cholest-5-en-3beta-yl (Z)-octadec-9-en-1-yl carbonate |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] [(Z)-octadec-9-enyl] carbonate |
| Molecular Weight | 681.1 g/mol |
| Molecular Formula | C46H80O3 |
| InChI | InChI=1S/C46H80O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-48-44(47)49-39-30-32-45(5)38(35-39)26-27-40-42-29-28-41(37(4)25-23-24-36(2)3)46(42,6)33-31-43(40)45/h14-15,26,36-37,39-43H,7-13,16-25,27-35H2,1-6H3/b15-14-/t37-,39+,40+,41-,42+,43+,45+,46-/m1/s1 |
| InChI Key | XMPIMLRYNVGZIA-TZOMHRFMSA-N |
| Boiling Point | 633.5 °C |
| Melting Point | 20 °C |
| Purity | 95% |
| Density | 0.94 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.06 |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
