Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1216 |
| Product Name | Cholesteryl Nonanoate |
| CAS | 1182-66-7 |
| Structure |  |
| Synonyms | Cholest-5-ene-3-beta-yl nonanoate;Cholest-5-en-3-ol (3beta)-, nonanoate |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nonanoate |
| Molecular Weight | 526.9 g/mol |
| Molecular Formula | C36H62O2 |
| InChI | InChI=1S/C36H62O2/c1-7-8-9-10-11-12-16-34(37)38-29-21-23-35(5)28(25-29)17-18-30-32-20-19-31(27(4)15-13-14-26(2)3)36(32,6)24-22-33(30)35/h17,26-27,29-33H,7-16,18-25H2,1-6H3/t27-,29+,30+,31-,32+,33+,35+,36-/m1/s1 |
| InChI Key | WCLNGBQPTVENHV-MKQVXYPISA-N |
| Boiling Point | 360 °C |
| Melting Point | 74-77 °C |
| Purity | 95% |
| Density | 0.96 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Isomeric SMILES | CCCCCCCCC(=O)O[C@H]1CC[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC=C2C1)CC[C@@H]4[C@H](C)CCCC(C)C)C)C |
What is the chemical formula of Cholesteryl pelargonate?
The chemical formula of Cholesteryl pelargonate is C36H62O2.
What is the CAS number of Cholesteryl pelargonate?
The CAS number of Cholesteryl pelargonate is 1182-66-7.
What are some synonyms for Cholesteryl pelargonate?
Some synonyms for Cholesteryl pelargonate include PELARGONIC ACID CHOLESTEROL ESTER and NONANOIC ACID CHOLESTEROL ESTER.
What is the melting point of Cholesteryl pelargonate?
The melting point of Cholesteryl pelargonate is 74-77 °C.
In what types of solvents is Cholesteryl pelargonate soluble?
Cholesteryl pelargonate is soluble in Chloroform and Tetrahydrofuran(THF), but insoluble in water.
How is Cholesteryl pelargonate commonly used?
Cholesteryl pelargonate is used in hair colors, cosmetic products like lip products, lotions, and in the manufacture of some pleochroic dyes. It can also be used as a component of liquid crystals for liquid crystal displays.
What is the safety information for Cholesteryl pelargonate?
Cholesteryl pelargonate has Safety Statements 24/25, indicating it should be handled properly. It has a WGK Germany rating of 3, and is listed on TSCA.
What is the molecular weight of Cholesteryl pelargonate?
The molecular weight of Cholesteryl pelargonate is 526.88 g/mol.
What is the boiling point of Cholesteryl pelargonate?
The boiling point of Cholesteryl pelargonate is 360 °C.
In what type of storage condition should Cholesteryl pelargonate be kept?
Cholesteryl pelargonate should be sealed in dry conditions at room temperature for storage.
If you have any questions, please contact us. You will get a satisfactory answer.
