Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0205 |
| Product Name | Chlorphenesin |
| CAS | 104-29-0 |
| Structure |  |
| Synonyms | 1,2-Propanediol, 3-(p-chlorophenoxy)-;3-(p-Chlorophenoxy)-1,2-propanediol |
| IUPAC Name | 3-(4-chlorophenoxy)propane-1,2-diol |
| Molecular Weight | 202.63 g/mol |
| Molecular Formula | C9H11ClO3 |
| InChI | InChI=1S/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
| InChI Key | MXOAEAUPQDYUQM-UHFFFAOYSA-N |
| Boiling Point | 291 °C |
| Melting Point | 77-79 °C |
| Purity | 95% |
| Density | 1.24 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1OCC(CO)O)Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
