Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0291 |
| Product Name | 4-Chlororesorcinol |
| CAS | 95-88-5 |
| Structure |  |
| Synonyms | 2,4-Dihydroxychlorobenzene |
| IUPAC Name | 4-chlorobenzene-1,3-diol |
| Molecular Weight | 144.56 g/mol |
| Molecular Formula | C6H5ClO2 |
| InChI | InChI=1S/C6H5ClO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H |
| InChI Key | JQVAPEJNIZULEK-UHFFFAOYSA-N |
| Boiling Point | 147 °C / 18mmHg |
| Melting Point | 106-108 °C |
| Purity | 0.95 |
| Density | 1.26 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1O)O)Cl |
| pKa | 8.28±0.10 |
What is the chemical formula of 4-Chlororesorcinol?
The chemical formula of 4-Chlororesorcinol is C6H5ClO2.
What is the melting point of 4-Chlororesorcinol?
The melting point of 4-Chlororesorcinol is 106-108 °C.
In what form does 4-Chlororesorcinol exist?
4-Chlororesorcinol exists in the form of a powder.
What color is indicative of 4-Chlororesorcinol?
4-Chlororesorcinol is beige in color.
Can 4-Chlororesorcinol react with ferric chloride?
Yes, 4-Chlororesorcinol reacts with ferric chloride to generate blue-purple.
What is the common usage of 4-Chlororesorcinol in cosmetics?
4-Chlororesorcinol is used in the formulation of hair dyes, colors, and tints in cosmetics.
How is 4-Chlororesorcinol synthesized?
4-Chlororesorcinol is synthesized by reacting resorcinol with dichlorosulfuryl.
Is 4-Chlororesorcinol flammable or non-flammable?
4-Chlororesorcinol is non-flammable.
What safety concerns are associated with exposure to high concentrations of 4-Chlororesorcinol?
Exposure to high concentrations of 4-Chlororesorcinol can cause skin irritation, serious eye irritation, and other hazards.
How is 4-Chlororesorcinol purified?
4-Chlororesorcinol can be purified by crystallizing it from boiling CCl4 and drying it in the air.
If you have any questions, please contact us. You will get a satisfactory answer.
