Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1091 |
Product Name | Cetylhydroxyproline Palmitamide |
CAS | 791838-11-4 |
Synonyms | hexadecyl (2S,4R)-1-hexadecanoyl-4-hydroxypyrrolidine-2-carboxylate |
IUPAC Name | hexadecyl (2S,4R)-1-hexadecanoyl-4-hydroxypyrrolidine-2-carboxylate |
Molecular Weight | 594 g/mol |
Molecular Formula | C37H71NO4 |
InChI | InChI=1S/C37H71NO4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-42-37(41)35-32-34(39)33-38(35)36(40)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h34-35,39H,3-33H2,1-2H3/t34-,35+/m1/s1 |
InChI Key | GOVINWHEYOSPAK-GPOMZPHUSA-N |
Appearance | Solid |
Highest Usage In Residency Products | 0.001 |
Isomeric SMILES | CCCCCCCCCCCCCCCCOC(=O)[C@@H]1C[C@H](CN1C(=O)CCCCCCCCCCCCCCC)O |
What is the chemical formula for Cetylhydroxyproline Palmitamide?
The chemical formula for Cetylhydroxyproline Palmitamide is C37H74N2O4.
What is the molecular weight of Cetylhydroxyproline Palmitamide?
The molecular weight of Cetylhydroxyproline Palmitamide is 610.99446.
Is there any other name or synonym for Cetylhydroxyproline Palmitamide?
Yes, another name or synonym for Cetylhydroxyproline Palmitamide is CETYLHYDROXYPROLINE PALMITAMIDE.
Can Cetylhydroxyproline Palmitamide be used in combination with other skincare ingredients?
Yes, Cetylhydroxyproline Palmitamide is often used in combination with other active ingredients like peptides, antioxidants, and moisturizers for enhanced skincare benefits.
What is the chemical structure of Cetylhydroxyproline Palmitamide?
The chemical structure of Cetylhydroxyproline Palmitamide is C37H74N2O4.
How is Cetylhydroxyproline Palmitamide commonly used in products?
Cetylhydroxyproline Palmitamide is commonly used in skincare and beauty products for its anti-aging and moisturizing properties.
What are the potential benefits of using products containing Cetylhydroxyproline Palmitamide?
Some potential benefits of using products containing Cetylhydroxyproline Palmitamide include improved skin firmness, elasticity, and hydration.
Are there any known side effects or risks associated with Cetylhydroxyproline Palmitamide?
Cetylhydroxyproline Palmitamide is generally considered safe for topical use, but individuals with sensitive skin may experience irritation or allergic reactions.