Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0059 |
| Product Name | Carbomer 934 |
| CAS | 9007-16-3 |
| Structure |  |
| Synonyms | Carbomer |
| IUPAC Name | 2-methylbutanoic acid |
| Molecular Weight | 713.1 g/mol |
| Molecular Formula | C42H80O8 |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChI Key | WLAMNBDJUVNPJU-UHFFFAOYSA-N |
| Boiling Point | 116 °C |
| Purity | 0.98 |
| Density | 1.2 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.15 |
| Highest Usage In Rinsing Products | 0.15 |
| Isomeric SMILES | CCC(C)C(=O)O |
What is the chemical structure of Carbomer934?
Carbomer934 has the chemical formula C5H10O2.
What is the molecular weight of Carbomer934?
The molecular weight of Carbomer934 is 102.1317 g/mol.
What is the melting point of Carbomer934?
The melting point of Carbomer934 is greater than 255°C.
What is the boiling point of Carbomer934?
The boiling point of Carbomer934 is 116°C.
How is Carbomer934 stored?
Carbomer934 is stored at room temperature.
What are the hazard codes associated with Carbomer934?
The hazard code for Carbomer934 is T.
What are the risk and safety statements associated with Carbomer934?
The risk statements for Carbomer934 are 45-46, and the safety statements are 53-45.
What are some common uses of Carbomer934?
Carbomer934 is widely used in cosmetic, pharmaceutical, and household industries.
What is the chemical property of Carbomer934?
The chemical property of Carbomer934 is 4-11 Pas.
How is Carbomer934 produced?
Carbomer934 is a synthetic high molecular weight cross-linked water-soluble polymer of acrylic acid.
If you have any questions, please contact us. You will get a satisfactory answer.
