Our customer service representatives are available 24 hours a day, from Monday to Sunday.

4-Butylresorcinol

Online Inquiry

Catalog Number	CI-GU-0061
Product Name	4-Butylresorcinol
CAS	18979-61-8
Structure
Synonyms	4-Butylresorcin;4-Butylresorcinol;1,3-Dihydroxy-4-n-Butyl Benzene
IUPAC Name	4-butylbenzene-1,3-diol
Molecular Weight	166.22 g/mol
Molecular Formula	C10H14O2
InChI	InChI=1S/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3
InChI Key	CSHZYWUPJWVTMQ-UHFFFAOYSA-N
Melting Point	50.0-55.0 °C
Purity	95%
Density	1.092 g/mL
Appearance	White to pale yellow powder
Highest Usage In Residency Products	0.02
Isomeric SMILES	CCCCC1=C(C=C(C=C1)O)O
pKa	9.95±0.18

Custom Q&A

What is the chemical formula of 4-Butylresorcinol?

The chemical formula of 4-Butylresorcinol is C10H14O2.

What is the molecular weight of 4-Butylresorcinol?

The molecular weight of 4-Butylresorcinol is 166.22 g/mol.

What is the melting point of 4-Butylresorcinol?

The melting point of 4-Butylresorcinol is between 50.0 to 55.0 °C.

What is the boiling point of 4-Butylresorcinol?

The boiling point of 4-Butylresorcinol is 166°C/7mmHg.

What is the density of 4-Butylresorcinol?

The density of 4-Butylresorcinol is 1.092±0.06 g/cm3.

What is the solubility of 4-Butylresorcinol in DMSO?

4-Butylresorcinol is soluble in DMSO at 150 mg/mL.

What is the primary use of 4-Butylresorcinol?

4-Butylresorcinol is primarily used as a tyrosinase inhibitor.

How does 4-Butylresorcinol affect melanin production?

4-Butylresorcinol inhibits melanin production by inhibiting tyrosinase activity.

What is the history of 4-Butylresorcinol as a skin depigmenting agent?

4-Butylresorcinol was first reported for its hypopigmenting action in 1995 and has since been studied for its efficacy and safety in treating melasma.

How is 4-Butylresorcinol synthesized?

4-Butylresorcinol is synthesized by mixing resorcinol and n-heptane under nitrogen protection, followed by a series of reactions involving sodium hydroxide and n-butanol.

Online Inquiry