Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-GU-0207 |
Product Name | Butylparaben |
CAS | 94-26-8 |
Structure | ![]() |
Synonyms | Butyl Paraben, butyl parahydroxybenzoate |
IUPAC Name | butyl 4-hydroxybenzoate |
Molecular Weight | 194.23 g/mol |
Molecular Formula | C11H14O3 |
InChI | InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H3 |
InChI Key | QFOHBWFCKVYLES-UHFFFAOYSA-N |
Boiling Point | 156-157 °C / 3.5mmHg |
Melting Point | 67-70 °C |
Flash Point | 181°C |
Purity | 95% |
Density | 1.28 g/mL |
Appearance | Solid |
Isomeric SMILES | CCCCOC(=O)C1=CC=C(C=C1)O |
What is the chemical formula for Butylparaben?
The chemical formula for Butylparaben is C11H14O3.
What are some synonyms for Butylparaben?
Some synonyms for Butylparaben are Methylparaben Impurity 3, 2-butyl-4-hydroxybenzoic acid, and BUTYL CHEMOSEPT.
What is the solubility of Butylparaben in DMSO, ethyl acetate, and methanol?
Butylparaben is soluble in DMSO, ethyl acetate, and methanol.
What is the usage limit for Butylparaben in soy sauce according to Japan regulations?
In Japan, the usage limit for Butylparaben in soy sauce is 0.25 g/L.
What is the LD50 value for Butylparaben in mice through subcutaneous injection?
The LD50 value for Butylparaben in mice through subcutaneous injection is 16.0 g/kg.
How is Butylparaben produced?
Butylparaben is derived from the esterification between p-hydroxybenzoic acid and butanol.
What are the hazards associated with Butylparaben?
The hazards associated with Butylparaben include toxicity, flammability, and thermal decomposition.
How is Butylparaben used in pharmaceutical applications?
Butylparaben is used as an antimicrobial preservative in pharmaceutical suspensions by inhibiting DNA, RNA, and enzyme synthesis.
What are the safety considerations for using Butylparaben in cosmetics and pharmaceuticals?
While Butylparaben is generally considered safe for use, it has been associated with hypersensitivity reactions, contact dermatitis, and rare immediate reactions like urticaria and bronchospasm.