Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0191 |
| Product Name | 5-Bromo-5-Nitro-1,3-Dioxane |
| CAS | 30007-47-7 |
| Structure |  |
| Synonyms | 5-Bromo-5-nitro-1,3-dioxane;m-Dioxane, 5-bromo-5-nitro- |
| IUPAC Name | 5-bromo-5-nitro-1,3-dioxane |
| Molecular Weight | 212 g/mol |
| Molecular Formula | C4H6BrNO4 |
| InChI | InChI=1S/C4H6BrNO4/c5-4(6(7)8)1-9-3-10-2-4/h1-3H2 |
| InChI Key | XVBRCOKDZVQYAY-UHFFFAOYSA-N |
| Boiling Point | 280.8±40.0 °C |
| Melting Point | 58-60 °C |
| Purity | 95% |
| Density | 1.07 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1C(COCO1)([N+](=O)[O-])Br |
What is the chemical formula for 5-Bromo-5-nitro-1,3-dioxane?
The chemical formula for 5-Bromo-5-nitro-1,3-dioxane is C4H6BrNO4.
What is the molecular weight of 5-Bromo-5-nitro-1,3-dioxane?
The molecular weight of 5-Bromo-5-nitro-1,3-dioxane is 212.
What is the melting point of 5-Bromo-5-nitro-1,3-dioxane?
The melting point of 5-Bromo-5-nitro-1,3-dioxane is 58-60 °C.
What are the synonyms for 5-Bromo-5-nitro-1,3-dioxane?
Some of the synonyms for 5-Bromo-5-nitro-1,3-dioxane are 5-BROMO-5-NITRO-1,3-DIOXANE, BND, and BRONIDOX L.
How is 5-Bromo-5-nitro-1,3-dioxane used in cosmetic products?
5-Bromo-5-nitro-1,3-dioxane is commonly used as a stabilizer and preserving agent in rinse-off cosmetics.
What is the hazard code for 5-Bromo-5-nitro-1,3-dioxane?
The hazard code for 5-Bromo-5-nitro-1,3-dioxane is Xn.
What is the water solubility of 5-Bromo-5-nitro-1,3-dioxane?
5-Bromo-5-nitro-1,3-dioxane is soluble in water at 12.5mg/ml.
What is the storage temperature recommended for 5-Bromo-5-nitro-1,3-dioxane?
The storage temperature recommended for 5-Bromo-5-nitro-1,3-dioxane is 2-8°C.
How does 5-Bromo-5-nitro-1,3-dioxane exhibit antimicrobial properties?
5-Bromo-5-nitro-1,3-dioxane exhibits antimicrobial properties against a wide range of microorganisms including gram-negative and gram-positive bacteria, yeast, and fungi.
What are some of the product categories that 5-Bromo-5-nitro-1,3-dioxane belongs to?
5-Bromo-5-nitro-1,3-dioxane belongs to product categories such as Fungicide series, As anticorrosive antibacterial agent for cosmetics, and Industrial/Fine Chemicals.
If you have any questions, please contact us. You will get a satisfactory answer.
