Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1233 |
| Product Name | Batyl Alcohol |
| CAS | 544-62-7 |
| Structure |  |
| Synonyms | 1,2-Propanediol, 3-(octadecyloxy)-;3-(Octadecyloxy)-1,2-propanediol;Batyl alcohol |
| IUPAC Name | 3-octadecoxypropane-1,2-diol |
| Molecular Weight | 344.6 g/mol |
| Molecular Formula | C21H44O3 |
| InChI | InChI=1S/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3 |
| InChI Key | OGBUMNBNEWYMNJ-UHFFFAOYSA-N |
| Boiling Point | 419.5 °C |
| Melting Point | 71-73 °C |
| Purity | 95% |
| Density | 0.99 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCOCC(CO)O |
What is another name for Batyl alcohol?
1,2-Propanediol,3-(octadecyloxy)-; 1-o-octadecylglycerol; Glycerine1-monostearylether; glycerolmonooctadecylether; monooctadecyletherofglycerol; 2 3-DIHYDROXYPROPYL-1-OCTADECYL ETHER; 1-O-OCTADECYL-RAC-GLYCEROL; (+)-BATYL ALCOHOL
What is the chemical formula for Batyl alcohol?
C21H44O3
What is the melting point of Batyl alcohol?
71-73 °C
What is the boiling point of Batyl alcohol?
419.64°C
What is the color of Batyl alcohol?
White to Off-White
What is the primary use of Batyl alcohol?
Batyl Alcohol is used to synthesize amphiphilic alkylglycerolipids with antitumor activities. It is also used in cosmetic compounds for prevention or treatment of erythema or dermatitis or promotion of wound healing.
What is the safety statement associated with Batyl alcohol?
Safety Statements 22-24/25
What is the storage recommendation for Batyl alcohol?
Sealed in dry, Room Temperature
What is the purification method for Batyl alcohol?
Batyl alcohol crystallises from aqueous Me2CO, EtOH, or pet ether (b 40-60o).
What is the Chemical Abstracts Service (CAS) entry for Batyl alcohol?
CAS DataBase Reference 544-62-7
If you have any questions, please contact us. You will get a satisfactory answer.
