Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0578 |
| Product Name | Ascorbic Acid |
| CAS | 50-81-7 |
| Structure |  |
| Synonyms | Ascoltin |
| Description | Ascorbic acid is a naturally occurring organic compound and a form of Vitamin C. It is water-soluble and found in high concentrations in many types of fruits and vegetables, especially citrus fruits such as oranges and lemons. It is used in some beauty and skincare products due to its antioxidant properties. |
| IUPAC Name | (2R)-2-[(1S)-1,2-Dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| Molecular Weight | 176.12 g/mol |
| Molecular Formula | C6H8O6 |
| Canonical SMILES | C(C(C1C(=C(C(=O)O1)O)O)O)O |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 |
| InChI Key | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| Boiling Point | 227.71 °C |
| Melting Point | 190-194 °C |
| Flash Point | 180.4 °C |
| Purity | 99% |
| Density | 1.65 g/mL |
| Solubility | Insoluble in ether, chloroform, benzene, petroleum ether, oils, fats, fat solvents |
| Appearance | Solid |
| Storage | 5-30 °C |
| Features And Benefits | 1. Acts as an antioxidant 2. Brightens skin tone 3. Increases collagen production 4. Reduces the appearance of fine lines and wrinkles 5. Improves skin texture 6. Lightens hyperpigmentation 7. Protects skin from UV damage 8. Reduces inflammation 9. Hydrates skin 10. Enhances the effectiveness of other skincare ingredients |
| Isomeric SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| Topological Polar Surface Area | 107 Ų |
If you have any questions, please contact us. You will get a satisfactory answer.
