Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0205 |
| Product Name | Arginine |
| CAS | 74-79-3 |
| Structure |  |
| Synonyms | L-Arginine |
| Description | Arginine is an amino acid, which is one of the building blocks of proteins. It is classified as a semi-essential or conditionally essential amino acid, meaning that under certain circumstances, such as during growth or illness, the body may not be able to produce enough arginine and it must be obtained from the diet. Arginine has numerous biological functions in the body, including contributing to immune function, wound healing, hormone secretion, and blood flow regulation. |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| Molecular Weight | 174.2 g/mol |
| Molecular Formula | C6H14N4O2 |
| Canonical SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N |
| InChI | ODKSFYDXXFIFQN-BYPYZUCNSA-N |
| InChI Key | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
| Boiling Point | 305°C |
| Melting Point | 222 °C (dec.) (lit.) |
| Purity | 99%+ |
| Density | 1.23 g/mL |
| Appearance | white, crystalline powder that is water-soluble and odorless |
| Application | 1. Helps improve blood flow and circulation 2. Enhances athletic performance and endurance 3. Boosts immune system function 4. Supports wound healing and tissue repair 5. May aid in erectile dysfunction by improving blood flow to the genitals 6. Assists in reducing high blood pressure 7. Can act as a natural remedy for migraines and headaches by dilating blood vessels 8. May have anti-aging effects due to its role in collagen production. |
| Features And Benefits | 1. Increases blood flow to the skin 2. Stimulates collagen production 3. Boosts skin hydration 4. Improves skin texture and tone 5. Enhances skin elasticity 6. Supports wound healing 7. Provides antioxidant protection for the skin. |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N |
| pH | 10.5-12.0 (0.5M, H2O, 25°C) |
| Topological Polar Surface Area | 128 Ų |
Arginine, a semi-essential amino acid, plays a crucial role in skin and hair care due to its multifaceted biological properties. It is effective in enhancing skin hydration by supporting the regeneration of the skin's moisture-binding system and improving the adsorption of other natural moisturizing factors. Arginine is involved in collagen production and aids in the cellular immune response and tissue repair, contributing to improved skin barrier function. It serves as a neutralizer, viscosity modifier, and enhances the sensory profile of formulations, providing soothing benefits and reducing the irritation potential in topical preparations. In hair care, arginine conditions and moisturizes, working synergistically with other amino acids to reveal healthier, shinier hair with increased tensile strength. It is also instrumental in dilating capillaries and producing nitric oxide, thereby improving circulation, which can enhance the appearance of fullness and color in lips. In cases of arginine deficiency, particularly during growth phases or disturbed cornification processes, supplementation may be necessary to maintain optimal skin condition, as arginine also plays a role in maintaining the urea content of the skin and stabilizing its protective acid mantle.
What is Arginine, and where is it commonly found?
Arginine is a proteinogenic amino acid present in red algae, buckwheat, and human skin. It plays a vital role in supporting the regeneration of the skin's moisture-binding system and offers a relaxing effect. Additionally, Arginine is one of the natural moisturizing factors (NMFs) that aid in hydration and enhance the absorption of other NMFs like PCA.
How does Arginine benefit the skin?
Arginine facilitates skin regeneration processes by supporting the moisture-binding system and promoting collagen production. It plays a significant role in tissue repair, enhances barrier function, and serves as a neutralizer, viscosity modifier, and an aesthetic enhancer, improving the sensory profile of formulations. Furthermore, Arginine acts as a skin conditioner, reducing irritation potential.
Why is Arginine considered a semi-essential amino acid?
Arginine is classified as a semi-essential amino acid because the body typically produces it. However, in situations such as growth phases or disturbances in the cornification process, where natural production isn't sufficient, it needs to be supplied through nutrition. Deficiencies can lead to reductions in urea and other natural moisturizing factors, impacting skin hydration.
How does Arginine influence blood circulation?
L-arginine is crucial for the production of nitric oxide in the body, which plays a pivotal role in dilating capillaries and improving circulation. When applied topically, it can dilate blood vessels in areas such as the lips, enhancing blood flow, which can result in fuller and more vibrant lips.
What are Arginine's effects in hair care?
In hair care formulations, Arginine contributes to moisturizing and conditioning the hair. It also improves the adsorption of PCA, working well with other amino acids to reveal healthier, shinier hair with increased tensile strength.
Are there any specific applications of Arginine for skin soothing?
Arginine is noted for its soothing properties, as it may help reduce the perception of irritation-triggering stimuli. This might be due to its stabilizing effect on the skin's protective acid mantle, attributed to Arginine's buffer effects, though the exact mechanism remains not fully understood.
If you have any questions, please contact us. You will get a satisfactory answer.
