Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0205 |
| Product Name | Arginine |
| CAS | 74-79-3 |
| Structure |  |
| Synonyms | L-Arginine |
| Description | Arginine is an amino acid, which is one of the building blocks of proteins. It is classified as a semi-essential or conditionally essential amino acid, meaning that under certain circumstances, such as during growth or illness, the body may not be able to produce enough arginine and it must be obtained from the diet. Arginine has numerous biological functions in the body, including contributing to immune function, wound healing, hormone secretion, and blood flow regulation. |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| Molecular Weight | 174.2 g/mol |
| Molecular Formula | C6H14N4O2 |
| Canonical SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N |
| InChI | ODKSFYDXXFIFQN-BYPYZUCNSA-N |
| InChI Key | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1 |
| Boiling Point | 305°C |
| Melting Point | 222 °C (dec.) (lit.) |
| Purity | 99%+ |
| Density | 1.23 g/mL |
| Appearance | white, crystalline powder that is water-soluble and odorless |
| Application | 1. Helps improve blood flow and circulation 2. Enhances athletic performance and endurance 3. Boosts immune system function 4. Supports wound healing and tissue repair 5. May aid in erectile dysfunction by improving blood flow to the genitals 6. Assists in reducing high blood pressure 7. Can act as a natural remedy for migraines and headaches by dilating blood vessels 8. May have anti-aging effects due to its role in collagen production. |
| Features And Benefits | 1. Increases blood flow to the skin 2. Stimulates collagen production 3. Boosts skin hydration 4. Improves skin texture and tone 5. Enhances skin elasticity 6. Supports wound healing 7. Provides antioxidant protection for the skin. |
| Isomeric SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N |
| pH | 10.5-12.0 (0.5M, H2O, 25°C) |
| Topological Polar Surface Area | 128 Ų |
If you have any questions, please contact us. You will get a satisfactory answer.
