Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0120 |
| Product Name | Arachidic Acid |
| CAS | 506-30-9 |
| Structure |  |
| Synonyms | n-Eicosansαure |
| IUPAC Name | icosanoic acid |
| Molecular Weight | 312.54 g/mol |
| Molecular Formula | C20H40O2 |
| InChI | InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22) |
| InChI Key | VKOBVWXKNCXXDE-UHFFFAOYSA-N |
| Boiling Point | 328 °C |
| Melting Point | 74-76 °C |
| Flash Point | 110 °C |
| Purity | 0.98 |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0008 |
| Highest Usage In Rinsing Products | 0.003 |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCCC(=O)O |
What is another name for arachidic acid?
Eicosanoic acid or Icosanoic acid
What is the chemical formula of arachidic acid?
CH3(CH2)18COOH
What is the melting point of arachidic acid?
74-76 °C
What is the main source of arachidic acid?
Groundnut (peanut) oil
In what products is arachidic acid used?
Pharmaceuticals, soaps, cosmetics, food packaging
How is arachidic acid obtained from food?
By catalytic hydrogenation of arachidonic acid
What is the role of arachidic acid in the production of liquid crystals?
It is used as an organic thin film
What are the safety hazard codes associated with arachidic acid?
Xi,Xn
What is the solubility of arachidic acid in water?
Practically insoluble
What are some reactions that arachidic acid can undergo?
Reacting with NaHCO3 to form salts, reacting with alcohols to form esters, among others.
If you have any questions, please contact us. You will get a satisfactory answer.
