Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-HC-0311 |
Product Name | 2-Amino-6-Chloro-4-Nitrophenol |
CAS | 6358-09-4 |
Structure | ![]() |
Synonyms | 2-Amino-4-nitro-6-chloro |
IUPAC Name | 2-amino-6-chloro-4-nitrophenol |
Molecular Weight | 188.57 g/mol |
Molecular Formula | C6H5ClN2O3 |
InChI | InChI=1S/C6H5ClN2O3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H,8H2 |
InChI Key | TWLMSPNQBKSXOP-UHFFFAOYSA-N |
Boiling Point | 358.7±42.0 °C |
Melting Point | 158-162.5 °C |
Purity | 0.95 |
Density | 1.66 g/mL |
Appearance | Orange powder |
Isomeric SMILES | C1=C(C=C(C(=C1N)O)Cl)[N+](=O)[O-] |
What is the chemical formula of 2-Amino-6-chloro-4-nitrophenol?
The chemical formula of 2-Amino-6-chloro-4-nitrophenol is C6H5ClN2O3.
What is the molecular weight of 2-Amino-6-chloro-4-nitrophenol?
The molecular weight of 2-Amino-6-chloro-4-nitrophenol is 188.57.
What is the melting point of 2-Amino-6-chloro-4-nitrophenol?
The melting point of 2-Amino-6-chloro-4-nitrophenol is 158-162.5℃.
What is the boiling point of 2-Amino-6-chloro-4-nitrophenol?
The boiling point of 2-Amino-6-chloro-4-nitrophenol is predicted to be 358.7±42.0 °C.
What is the color of 2-Amino-6-chloro-4-nitrophenol?
The color of 2-Amino-6-chloro-4-nitrophenol is orange.
What is the water solubility of 2-Amino-6-chloro-4-nitrophenol?
The water solubility of 2-Amino-6-chloro-4-nitrophenol is 450mg/L at 25℃.
What is the hazard code for 2-Amino-6-chloro-4-nitrophenol?
The hazard code for 2-Amino-6-chloro-4-nitrophenol is Xi.
What is the primary usage of 2-Amino-6-chloro-4-nitrophenol?
2-Amino-6-chloro-4-nitrophenol has cosmetic application in hair dye compositions.
Is 2-Amino-6-chloro-4-nitrophenol classified as flammable or explosive?
2-Amino-6-chloro-4-nitrophenol is not classified as flammable or explosive.
What is the storage recommendation for 2-Amino-6-chloro-4-nitrophenol?
It is recommended to keep 2-Amino-6-chloro-4-nitrophenol in a dark place, in an inert atmosphere, at room temperature.