Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0046 |
| Product Name | Lycopene |
| CAS | 502-65-8 |
| Structure |  |
| Synonyms | CI 75125 |
| IUPAC Name | (6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene |
| Molecular Weight | 536.87 g/mol |
| Molecular Formula | C40H56 |
| InChI | InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
| InChI Key | OAIJSZIZWZSQBC-GYZMGTAESA-N |
| Boiling Point | 645 °C |
| Melting Point | 172-173 °C |
| Purity | 95% |
| Density | 0.938 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC(=CCC/C(=C/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)\C)\C)\C)/C)/C)/C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
