Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-0543 |
Product Name | Chitosan |
CAS | 9012-76-4 |
Synonyms | Chitin, deacylated |
Description | Active ingredient chitosan is de-acylated chitin. Derived from crustacean shells. Used as film-former and hair-fixative. Also used as deodorising agent. It possesses antimicrobial and excellent skin care properties. It prevents the excessive generation of odor-forming substances. |
IUPAC Name | Methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-[(2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4-hydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-4-hydroxy-6-(hydroxymethyl)oxan-3-yl]carbamate |
Molecular Weight | 1526.5 g/mol |
Molecular Formula | C6H13NO4 |
Canonical SMILES | COC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)N)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)N)O)CO)CO)CO)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O |
InChI | InChI=1S/C56H103N9O39/c1-87-56(86)65-28-38(84)46(19(10-74)96-55(28)104-45-18(9-73)95-49(27(64)37(45)83)97-39-12(3-67)88-47(85)20(57)31(39)77)103-54-26(63)36(82)44(17(8-72)94-54)102-53-25(62)35(81)43(16(7-71)93-53)101-52-24(61)34(80)42(15(6-70)92-52)100-51-23(60)33(79)41(14(5-69)91-51)99-50-22(59)32(78)40(13(4-68)90-50)98-48-21(58)30(76)29(75)11(2-66)89-48/h11-55,66-85H,2-10,57-64H2,1H3,(H,65,86)/t11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48+,49+,50+,51+,52+,53+,54+,55+/m1/s1 |
InChI Key | FLASNYPZGWUPSU-SICDJOISSA-N |
Melting Point | 102.5 °C |
Purity | 95% |
Density | 1.0 g/mL |
Appearance | Fine, off-white powder, characteristic odor |
Application | In the agricultural sector: as growth promoters, bio-pesticides, feed additives, seed treatment. |
Storage | Store light-protected at a cool and dry place |
HS Code | 2936210000 |
INCI | Chitosan |
pH | 7.0-8.0 |
Refractive Index | 1.7 |
What is the chemical formula of chitosan?
The chemical formula of chitosan is C6H11NO4X2.
What are the synonyms for chitosan?
The synonyms for chitosan include kytexm, poliglusam, seacuref, seacureplus, CHITOSANNANOPARTICLES, LOWMOLECULARWEIGHTCHITOSAN, and HIGHMOLECULARWEIGHTCHITOSAN.
What is the melting point of chitosan?
The melting point of chitosan is 102.5 °C.
In what type of solution is chitosan soluble?
Chitosan is soluble in dilute aqueous acid with a pH of less than 6.5.
What are some of the uses of chitosan?
Chitosan is used as a flocculant, protein precipitation agent, encapsulating agent, aqueous thickener, and has various applications in fields such as tissue engineering, biomedical, cosmetics, and wastewater treatment.
What are some of the physiological roles and efficacy of chitosan?
Chitosan has various effects such as lowering serum cholesterol, regulating intestinal flora, reducing blood pressure, improving immunity, preventing cancer, and more.
What is the antibacterial activity of chitosan?
Chitosan has broad antibacterial activity, with different concentrations having different effects on various types of bacteria.
How is chitosan typically prepared?
Chitosan is typically prepared through the deacetylation of chitin, using enzymatic or chemical processes.
What is the color and odor of chitosan?
Chitosan is described as white to off-white in color and odorless in the reference.
Where does chitosan occur naturally and what is its main resource?
Chitosan occurs naturally in the shells of marine crustaceans, and its main resource is chitin.