Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0079 |
| Product Name | Zinc gluconate |
| CAS | 4468-02-4 |
| Structure |  |
| Synonyms | bis(D-gluconato-κO1,κO2)-,(T-4)-Zinc |
| IUPAC Name | zinc;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight | 455.68 g/mol |
| Molecular Formula | C12H22O14Zn |
| InChI | InChI=1S/2C6H12O7.Zn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key | WHMDKBIGKVEYHS-IYEMJOQQSA-L |
| Boiling Point | 319 °C |
| Melting Point | 172-175 °C |
| Purity | 0.95 |
| Density | 1.44 g/mL |
| Solubility | Soluble in water |
| Appearance | White to off-white solid |
| Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Zn+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
