Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1126 |
| Product Name | Zinc Aspartate |
| CAS | 36393-20-1 |
| Structure |  |
| Synonyms | L-Aspartic acid zinc salt |
| IUPAC Name | zinc;(2S)-2-aminobutanedioate |
| Molecular Weight | 329.6 g/mol |
| Molecular Formula | C8H12N2O8Zn |
| InChI | InChI=1S/C4H7NO4.Zn/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+2/p-2/t2-;/m0./s1 |
| InChI Key | ORCZNRDIGZRGLV-DKWTVANSSA-L |
| Purity | 95% |
| Appearance | Solid |
| Isomeric SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].[Zn+2] |
Are there any known side effects or precautions associated with the use of zinc aspartate in skincare?
There are no known side effects associated with the use of zinc aspartate in skincare, but it is always recommended to perform a patch test before applying any new product on the skin.
What are the synonyms for ZINC ASPARTATE?
The synonyms are also ZINC ASPARTATE.
What is the molecular formula of ZINC ASPARTATE?
The molecular formula is C8H12N2O8Zn.
What is the molecular weight of ZINC ASPARTATE?
The molecular weight is 329.58.
What is the primary usage of zinc aspartate?
Zinc aspartate is used as a skin-conditioning agent.
What is zinc aspartate chemically composed of?
Zinc aspartate is the zinc salt of aspartic acid.
How is zinc aspartate used in skincare products?
Zinc aspartate is used to condition the skin.
What is the role of zinc in aspartate in skincare?
Zinc helps in conditioning the skin, while aspartate aids in the absorption of the zinc.
How does zinc aspartate benefit the skin?
Zinc aspartate helps in maintaining healthy skin by providing necessary nutrients and promoting skin health.
If you have any questions, please contact us. You will get a satisfactory answer.
