Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0096 |
| Product Name | Xylitylglucoside |
| CAS | 1095751-96-4 |
| Synonyms | D-Xylitol, 5-O-β-D-glucopyranosyl- |
| IUPAC Name | (2S,3R,4R)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentane-1,2,3,4-tetrol |
| Molecular Weight | 314.29 g/mol |
| Molecular Formula | C11H22O10 |
| InChI | InChI=1S/C11H22O10/c12-1-4(14)7(16)5(15)3-20-11-10(19)9(18)8(17)6(2-13)21-11/h4-19H,1-3H2/t4-,5+,6+,7+,8+,9-,10+,11+/m0/s1 |
| InChI Key | LTBAFRQKFIMYQK-DLWPFLMGSA-N |
| Boiling Point | 730.9±60.0 °C |
| Density | 1.66 g/mL |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC[C@H]([C@@H]([C@H](CO)O)O)O)O)O)O)O |
| pKa | 12.89±0.70 |
Xylitylglucoside is an innovative skincare ingredient derived from the glycosylation of xylitol, a polyol sugar renowned for its moisturizing properties. Sourced from natural sugars in wheat and wood cellulose, this dual-action compound significantly enhances the skin's hydration levels. It works by boosting the dermal water reservoirs and stimulating the production of hyaluronic acid, thereby effectively improving the epidermal water content and promoting healthier, more hydrated skin.
What is Xylitylglucoside and how is it derived?
Xylitylglucoside is a product of the glycosylation of xylitol, which is a polyol sugar. It is a natural hydrophilic skincare ingredient derived from the sugars found in wheat and wood cellulose.
What are the primary benefits of using Xylitylglucoside in skincare?
Xylitylglucoside is valued for its moisturizing properties. It dramatically improves the epidermal water content, enhances the dermal water reservoirs, and boosts hyaluronic acid production in the skin, resulting in more hydrated and healthy skin.
How does Xylitylglucoside improve skin hydration?
Xylitylglucoside increases the dermal water reservoirs and supports the production of hyaluronic acid in the skin. This dual-action approach helps to maintain optimal moisture levels, leading to improved hydration and overall skin appearance.
Is Xylitylglucoside suitable for all skin types?
Xylitylglucoside is generally suitable for all skin types due to its natural origin and hydrophilic properties that focus on enhancing skin moisture. However, users with specific skin concerns or conditions should consult with a dermatologist or skincare professional prior to use.
How is Xylitylglucoside different from other moisturizing agents?
Unlike some other moisturizing agents, Xylitylglucoside not only directly hydrates the skin but also enhances the skin's ability to retain moisture by supporting the production of natural components like hyaluronic acid, making it a comprehensive hydrating solution.
Can Xylitylglucoside be used in combination with other skincare ingredients?
Yes, Xylitylglucoside can typically be combined with other skincare ingredients. Its moisture-enhancing properties can complement various formulations. Nonetheless, patch testing is recommended when incorporating new products into your skincare routine.
If you have any questions, please contact us. You will get a satisfactory answer.
