Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0024 |
| Product Name | Usnic Acid |
| CAS | 125-46-2 |
| Structure |  |
| Synonyms | 1,3(2H,9bH)-Dibenzofurandione, 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl- |
| IUPAC Name | 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| Molecular Weight | 344.3 g/mol |
| Molecular Formula | C18H16O7 |
| InChI | InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,11,22-23H,1-4H3 |
| InChI Key | CUCUKLJLRRAKFN-UHFFFAOYSA-N |
| Boiling Point | 399.5 °C |
| Melting Point | 200 °C |
| Purity | 95% |
| Density | 1.287 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0005 |
| Highest Usage In Rinsing Products | 0.0025 |
| Isomeric SMILES | CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)O |
| pKa | 4.00±0.40 |
If you have any questions, please contact us. You will get a satisfactory answer.
