Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0184 |
| Product Name | Undecylenic Acid |
| CAS | 112-38-9 |
| Structure |  |
| Synonyms | Undec-10-enoic acid, 10-Undecenoic acid |
| IUPAC Name | undec-10-enoic acid |
| Molecular Weight | 184.27 g/mol |
| Molecular Formula | C11H20O2 |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H,12,13) |
| InChI Key | FRPZMMHWLSIFAZ-UHFFFAOYSA-N |
| Boiling Point | 137 °C / 2mmHg |
| Melting Point | 23-25 °C |
| Purity | 95% |
| Density | 0.91 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | C=CCCCCCCCCC(=O)O |
| pKa | 4.78±0.10 |
What is the chemical formula of undecylenic acid?
The chemical formula of undecylenic acid is C11H20O2.
What is one of the key uses of undecylenic acid in pharmaceuticals?
Undecylenic acid is used in pharmaceuticals for treating skin infections.
How is undecylenic acid derived?
Undecylenic acid is derived from castor oil by cracking.
What is the appearance of undecylenic acid at 25°C?
Undecylenic acid appears as either a white or very pale yellow crystalline mass, or as a clear colorless pale yellow liquid.
In what type of products is undecylenic acid commonly used in the cosmetics industry?
Undecylenic acid is commonly used in antidandruff shampoos and antimicrobial powders within the cosmetics industry.
What is the solubility of undecylenic acid in water?
Undecylenic acid is insoluble in water.
How is undecylenic acid used in silicon-based biosensors?
Undecylenic acid can be used to make monolayers on bare silicon transducer surfaces with covalent bonds, enabling the conjugation of biomolecules like DNA or proteins.
What safety measures should be taken when handling undecylenic acid?
Safety measures include using appropriate protective equipment and storing undecylenic acid below +30°C.
What is the odor description of undecylenic acid?
The odor of undecylenic acid is described as sweet and woody.
What is one of the synonyms for undecylenic acid as a drug for skin problems?
One of the synonyms for undecylenic acid as a drug for skin problems is benzevrine.
If you have any questions, please contact us. You will get a satisfactory answer.
