Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0111 |
| Product Name | Trisodium NTA |
| CAS | 5064-31-3 |
| Structure |  |
| Synonyms | Trisodium nitrilotriacetate |
| IUPAC Name | trisodium;2-[bis(carboxylatomethyl)amino]acetate |
| Molecular Weight | 257.08 g/mol |
| Molecular Formula | C6H6NNa3O6 |
| InChI | InChI=1S/C6H9NO6.3Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;/q;3*+1/p-3 |
| InChI Key | DZCAZXAJPZCSCU-UHFFFAOYSA-K |
| Purity | 0.98 |
| Density | 1.77 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C(C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+] |
| pKa | 1.22 |
If you have any questions, please contact us. You will get a satisfactory answer.
