Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1318 |
| Product Name | Trisodium EDTA |
| CAS | 150-38-9 |
| Structure |  |
| Synonyms | thylenediaminetetraacetic acid trisodium salt solution |
| IUPAC Name | trisodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| Molecular Weight | 361.21 g/mol |
| Molecular Formula | C10H16N2Na3O8 |
| InChI | InChI=1S/C10H16N2O8.3Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;/q;3*+1/p-3 |
| InChI Key | QZKRHPLGUJDVAR-UHFFFAOYSA-K |
| Melting Point | 237 °C |
| Purity | 0.98 |
| Density | 1.69 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[Na+].[Na+].[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
