Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0056 |
| Product Name | Tripropylene Glycol |
| CAS | 24800-44-0 |
| Structure |  |
| Synonyms | PPG-3;Propanol, ((1-methyl-1,2-ethanediyl)bis(oxy))bis- |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| Molecular Weight | 192.25 g/mol |
| Molecular Formula | C9H20O4 |
| InChI | InChI=1S/C9H20O4/c1-7(11)5-12-9(3)6-13-8(2)4-10/h7-11H,4-6H2,1-3H3 |
| InChI Key | LCZVSXRMYJUNFX-UHFFFAOYSA-N |
| Boiling Point | 273 °C |
| Melting Point | -45 °C |
| Purity | 95% |
| Density | 1.02 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0813 |
| Isomeric SMILES | CC(CO)OCC(C)OCC(C)O |
If you have any questions, please contact us. You will get a satisfactory answer.
