Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1180 |
Product Name | Tripalmitin |
CAS | 555-44-2 |
Structure | |
Synonyms | Glycerol tripalmitate;Hexadecanoic acid, 1,2,3-propanetriyl ester;Glyceryl tripalmitate |
IUPAC Name | 2,3-di(hexadecanoyloxy)propyl hexadecanoate |
Molecular Weight | 807.3 g/mol |
Molecular Formula | C51H98O6 |
InChI | InChI=1S/C51H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-47H2,1-3H3 |
InChI Key | PVNIQBQSYATKKL-UHFFFAOYSA-N |
Boiling Point | 310-320 °C |
Melting Point | 66-68 °C |
Purity | 95% |
Density | 0.88 g/mL |
Appearance | Solid |
Highest Usage In Residency Products | 0.00804 |
Highest Usage In Rinsing Products | 0.0225 |
Isomeric SMILES | CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC |
What is the molecular formula of TRIPALMITIN?
The molecular formula of Tripalmitin is C51H98O6.
What is the melting point of TRIPALMITIN?
The melting point of Tripalmitin is 66-68 °C.
What is the boiling point of TRIPALMITIN?
The boiling point of Tripalmitin is in the range of 310-320°C.
What is the chemical property of TRIPALMITIN that allows it to be soluble in certain solvents?
Tripalmitin is soluble in chloroform (sparingly), ethyl acetate (slightly), and hexanes (very slightly).
What is the hazard code assigned to TRIPALMITIN?
The hazard code assigned to Tripalmitin is Xn.
What is the main use of TRIPALMITIN in drug delivery?
Tripalmitin is used in the preparation of solid lipid particles for oral delivery of drugs.
How is Tripalmitin used in cosmetic products?
Tripalmitin is used in cosmetic products as thickening and skin-conditioning agents.
What is the definition of Tripalmitin according to ChEBI?
According to ChEBI, Tripalmitin is a triglyceride obtained by formal acylation of the three hydroxy groups of glycerol by palmitic (hexadecanoic) acid.
How can Tripalmitin be purified?
Tripalmitin can be crystallized from acetone, diethyl ether, or EtOH for purification.
What is the role of glyceryl tripalmitate in drug delivery?
Glyceryl tripalmitate is a carrier molecule for effective drug delivery and is used in solid lipid nanoparticle formulations.