Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0213 |
| Product Name | Triclosan |
| CAS | 3380-34-5 |
| Structure |  |
| Synonyms | Trichlorohydroxydiphenyl ether, 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| Molecular Weight | 289.54 g/mol |
| Molecular Formula | C12H7Cl3O2 |
| InChI | InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H |
| InChI Key | XEFQLINVKFYRCS-UHFFFAOYSA-N |
| Boiling Point | 290 °C |
| Melting Point | 56-60 °C |
| Purity | 95% |
| Density | 1.42 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
