Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0218 |
| Product Name | Triclocarban |
| CAS | 101-20-2 |
| Structure |  |
| Synonyms | 3,4,4'-Trichloro-carbanilid |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
| Molecular Weight | 315.6 g/mol |
| Molecular Formula | C13H9Cl3N2O |
| InChI | InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| InChI Key | ICUTUKXCWQYESQ-UHFFFAOYSA-N |
| Boiling Point | 344.2±42.0 °C |
| Melting Point | 254-256 °C |
| Purity | 95% |
| Density | 1.57 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)Cl)Cl |
If you have any questions, please contact us. You will get a satisfactory answer.
