Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0218 |
| Product Name | Triclocarban |
| CAS | 101-20-2 |
| Structure |  |
| Synonyms | 3,4,4'-Trichloro-carbanilid |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
| Molecular Weight | 315.6 g/mol |
| Molecular Formula | C13H9Cl3N2O |
| InChI | InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| InChI Key | ICUTUKXCWQYESQ-UHFFFAOYSA-N |
| Boiling Point | 344.2±42.0 °C |
| Melting Point | 254-256 °C |
| Purity | 95% |
| Density | 1.57 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=CC=C1NC(=O)NC2=CC(=C(C=C2)Cl)Cl)Cl |
Triclocarban is an antimicrobial agent widely utilized for its efficacy against Gram-positive bacteria, making it an ideal component in deodorant soaps and a variety of other products including sticks, roll-ons, creams, and lotions where antibacterial properties are desired. Increasingly, both bar and liquid soaps designed for household and institutional settings incorporate bacteriostatic agents like Triclocarban. These formulations are effective in preventing the growth of resident and transient skin flora, notably the potentially harmful staphylococci, which can contribute to unpleasant odors from perspiration and are often implicated in skin diseases.
What is Triclocarban and what are its primary uses?
Triclocarban is an antimicrobial agent known for its wide activity against Gram-positive bacteria. It is commonly found in products that require antibacterial action, such as deodorant soaps, sticks, roll-ons, creams, and lotions.
Can Triclocarban be used in household and institutional products?
Yes, many bar and liquid soaps intended for both household and institutional use contain Triclocarban as a bacteriostatic agent. These products help prevent the proliferation of resident and transient skin flora, including dangerous staphylococci.
Why is Triclocarban included in deodorant products?
Triclocarban is effective in combating bacteria that act on perspiration to produce unpleasant odors. Its inclusion in deodorant products helps maintain personal hygiene by reducing odor-causing bacteria.
How does Triclocarban contribute to skin health?
By preventing the growth of harmful bacteria on the skin, Triclocarban reduces the risk of skin diseases caused by such bacteria. This makes it an effective ingredient in skincare products aimed at maintaining skin health.
What types of bacteria are particularly targeted by Triclocarban?
Triclocarban is particularly effective against Gram-positive bacteria, including staphylococci, which are common causes of skin diseases and are associated with unpleasant body odors.
If you have any questions, please contact us. You will get a satisfactory answer.
