Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0089 |
| Product Name | Trehalose |
| CAS | 99-20-7 |
| Structure |  |
| Synonyms | 1,1'-Oxybis(1-deoxy-α-D-glucopyranose) |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxane-3,4,5-triol |
| Molecular Weight | 342.3 g/mol |
| Molecular Formula | C12H22O11 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| InChI Key | HDTRYLNUVZCQOY-LIZSDCNHSA-N |
| Boiling Point | 397.76 °C |
| Melting Point | 203 °C |
| Density | 1.58 g/mL |
| Isomeric SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)O |
What is the molecular formula of Trehalose?
The molecular formula of Trehalose is C12H22O11.
How is Trehalose used in the skin care industry?
Trehalose is used as a humectant and moisturizer in skin care, helping to bind water in the skin and increase moisture content.
What is the relative sweetness of Trehalose compared to sucrose?
Trehalose has a relative sweetness of approximately 45% of that of sucrose.
How is Trehalose produced commercially?
Trehalose is prepared from liquefied starch through a multistep enzymatic process, with the commercial product being the dihydrate.
What are some potential pharmaceutical applications of Trehalose?
Trehalose is used for lyoprotection of therapeutic proteins, stabilization during freeze-thaw and lyophilization of liposomes, blood cells, cosmetics, and monoclonal antibodies.
What are some safety considerations when using Trehalose?
Trehalose is generally considered nontoxic and nonirritant, but excess amounts may cause discomfort in individuals with trehalase deficiency. It is used as a sweetener with less cariogenic potential than sucrose.
How is Trehalose metabolized in the gut?
Trehalose is rapidly metabolized to glucose by the specific enzyme trehalase in the gut.
How is Trehalose stored to maintain its stability?
Trehalose should be stored in a cool, dry place in a well-sealed container to prevent it from liquefying at high humidity.
What are some incompatibilities of Trehalose?
Trehalose is incompatible with strong oxidizing agents, particularly in the presence of heat.
In which industries is Trehalose commonly used?
Trehalose is used in the food industry as an artificial sweetener, in the pharmaceutical industry for protein preservation, and in skincare as a moisturizer and humectant.
If you have any questions, please contact us. You will get a satisfactory answer.
