Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0289 |
| Product Name | Toluene-3,4-Diamine |
| CAS | 496-72-0 |
| Structure |  |
| Synonyms | 3,4-Diaminotoluene |
| IUPAC Name | 4-methylbenzene-1,2-diamine |
| Molecular Weight | 122.17 g/mol |
| Molecular Formula | C7H10N2 |
| InChI | InChI=1S/C7H10N2/c1-5-2-3-6(8)7(9)4-5/h2-4H,8-9H2,1H3 |
| InChI Key | DGRGLKZMKWPMOH-UHFFFAOYSA-N |
| Boiling Point | 155-156 °C / 18mmHg |
| Melting Point | 87-89 °C |
| Purity | 0.98 |
| Density | 1.22 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=C(C=C1)N)N |
| pKa | 4.59±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
