Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0050 |
| Product Name | Tocotrienols |
| CAS | 6829-55-6 |
| Synonyms | Tocotrienol |
| IUPAC Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| Molecular Weight | 382.6 g/mol |
| Molecular Formula | C26H38O2 |
| InChI | InChI=1S/C26H38O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5)18-16-23-19-24(27)14-15-25(23)28-26/h9,11,13-15,19,27H,6-8,10,12,16-18H2,1-5H3/b21-11+,22-13+ |
| InChI Key | GJJVAFUKOBZPCB-ZGRPYONQSA-N |
| Boiling Point | 507.5±39.0 °C |
| Purity | 95% |
| Density | 0.973 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0195 |
| Isomeric SMILES | CC(=CCC/C(=C/CC/C(=C/CCC1(CCC2=C(O1)C=CC(=C2)O)C)/C)/C)C |
| pKa | 10.56±0.40 |
If you have any questions, please contact us. You will get a satisfactory answer.
