Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0050 |
| Product Name | Tocotrienols |
| CAS | 6829-55-6 |
| Synonyms | Tocotrienol |
| IUPAC Name | 2-methyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| Molecular Weight | 382.6 g/mol |
| Molecular Formula | C26H38O2 |
| InChI | InChI=1S/C26H38O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5)18-16-23-19-24(27)14-15-25(23)28-26/h9,11,13-15,19,27H,6-8,10,12,16-18H2,1-5H3/b21-11+,22-13+ |
| InChI Key | GJJVAFUKOBZPCB-ZGRPYONQSA-N |
| Boiling Point | 507.5±39.0 °C |
| Purity | 95% |
| Density | 0.973 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0195 |
| Isomeric SMILES | CC(=CCC/C(=C/CC/C(=C/CCC1(CCC2=C(O1)C=CC(=C2)O)C)/C)/C)C |
| pKa | 10.56±0.40 |
Tocotrienols, a subcategory of Vitamin E, are integral in the realm of skincare due to their potent antioxidant properties. This group of fat-soluble compounds, naturally present in various foods like walnuts, plays a critical role in safeguarding the skin against oxidative stress, caused by factors such as UV radiation, free radicals, and environmental pollutants. By preserving the skin's lipid barrier, tocotrienols help maintain its natural health and beauty. Known for their photoprotective and anti-photoaging effects, these compounds offer a robust defense against premature aging, thereby supporting the skin's original vitality and resilience.
What are tocotrienols, and how do they relate to Vitamin E?
Tocotrienols are a subset of Vitamin E, which is a group of lipid-soluble compounds essential for skin health. Vitamin E is composed of two major groups: tocopherols and tocotrienols, with each group containing four different types (alpha, beta, gamma, and delta). Tocotrienols are renowned for their potent antioxidant properties, which help protect the skin from oxidative stress and premature aging.
How do tocotrienols benefit the skin?
Tocotrienols are powerful antioxidants that play a crucial role in defending the skin from oxidative stress induced by environmental factors such as UV radiation, free radicals, and peroxides. These stressors significantly contribute to the aging process. Tocotrienols help preserve the skin's lipid barrier, support its natural beauty, and maintain its health. Additionally, they have photoprotective and anti-photoaging effects on skin cells, ensuring the skin remains youthful and resilient.
Why is Vitamin E considered an essential beauty vitamin?
Vitamin E, encompassing both tocopherols and tocotrienols, is deemed essential for beauty because of its significant antioxidative properties that combat oxidative stress-a key factor in aging. Tocotrienols, in particular, are highly effective in protecting the skin against environmental damage, thus maintaining its youthful appearance and overall health.
If you have any questions, please contact us. You will get a satisfactory answer.
