Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0055 |
| Product Name | Tocopheryl Succinate |
| CAS | 4345-03-3 |
| Structure |  |
| Synonyms | Vitamin E Succinate, Alpha-tocopheryl Hydrogen Succinate, D-alpha-Tocopherol succinate |
| IUPAC Name | 4-oxo-4-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]butanoic acid |
| Molecular Weight | 530.79 g/mol |
| Molecular Formula | C33H54O5 |
| InChI | InChI=1S/C33H54O5/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-20-33(8)21-19-28-27(7)31(25(5)26(6)32(28)38-33)37-30(36)18-17-29(34)35/h22-24H,9-21H2,1-8H3,(H,34,35)/t23-,24-,33-/m1/s1 |
| InChI Key | IELOKBJPULMYRW-NJQVLOCASA-N |
| Boiling Point | 625.8±55.0 °C |
| Melting Point | 76 °C |
| Purity | 95% |
| Density | 1.002 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | CC1=C(C(=C(C2=C1O[C@](CC2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)OC(=O)CCC(=O)O)C |
| pKa | 4.35±0.17 |
If you have any questions, please contact us. You will get a satisfactory answer.
