Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0044 |
| Product Name | Tocopheryl Linoleate |
| CAS | 36148-84-2 |
| Structure |  |
| Synonyms | 9,12-Octadecadienoic acid (Z,Z)-, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl ester;9,12-Octadecadienoic acid (9Z,12Z)-, (2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-((4R,8R)-4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl ester, rel-;DL-alpha-tocopheryl linoleate;Vitamin E linoleate |
| IUPAC Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| Molecular Weight | 693.1 g/mol |
| Molecular Formula | C47H80O3 |
| InChI | InChI=1S/C47H80O3/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-33-44(48)49-45-40(6)41(7)46-43(42(45)8)34-36-47(9,50-46)35-27-32-39(5)31-26-30-38(4)29-25-28-37(2)3/h14-15,17-18,37-39H,10-13,16,19-36H2,1-9H3/b15-14-,18-17-/t38-,39-,47-/m1/s1 |
| InChI Key | OFUHPGMOWVHNPN-QWZFGMNQSA-N |
| Boiling Point | 721.1±60.0 °C |
| Purity | 95% |
| Density | 0.92 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC1=C(C2=C(C(=C1C)C)O[C@](CC2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C |
What is the chemical formula of TOCOPHERYL LINOLEATE?
The chemical formula of TOCOPHERYL LINOLEATE is C47H80O3.
What is the molecular weight of TOCOPHERYL LINOLEATE?
The molecular weight of TOCOPHERYL LINOLEATE is 693.1363.
What are some synonyms of TOCOPHERYL LINOLEATE?
Some synonyms of TOCOPHERYL LINOLEATE are alpha-Tocopheryllinoleate, DL-ALPHA-TOCOPHERYL LINOLEATE, and 2,5,7,8-Tetramethyl-2-(4,8,12-trimethyltridecyl)-6-(linoleoyloxy)chroman.
What is the boiling point of TOCOPHERYL LINOLEATE?
The boiling point of TOCOPHERYL LINOLEATE is predicted to be 721.1±60.0 °C.
What is the density of TOCOPHERYL LINOLEATE?
The density of TOCOPHERYL LINOLEATE is predicted to be 0.920±0.06 g/cm3.
What is the LogP value of TOCOPHERYL LINOLEATE?
The LogP value of TOCOPHERYL LINOLEATE is estimated to be 18.029.
What is a common usage of TOCOPHERYL LINOLEATE?
TOCOPHERYL LINOLEATE is commonly used as an anti-oxidant and a skin-conditioning agent.
What is a synthetic version of vitamin E that is similar to TOCOPHERYL LINOLEATE?
Vitamin E linoleate is a synthetic version of vitamin E that is similar to TOCOPHERYL LINOLEATE.
What is one of the Product Categories that TOCOPHERYL LINOLEATE belongs to?
TOCOPHERYL LINOLEATE belongs to the Product Categories of UVCBs-organic.
What is the CAS number for TOCOPHERYL LINOLEATE?
The CAS number for TOCOPHERYL LINOLEATE is 36148-84-2.
If you have any questions, please contact us. You will get a satisfactory answer.
