Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0067 |
| Product Name | Tioxolone |
| CAS | 4991-65-5 |
| Structure |  |
| Synonyms | 6-Hydroxy-1,3-benzoxathiol-2-one |
| IUPAC Name | 6-hydroxy-1,3-benzoxathiol-2-one |
| Molecular Weight | 168.17 g/mol |
| Molecular Formula | C17H27NO3 |
| InChI | InChI=1S/C7H4O3S/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3,8H |
| InChI Key | SLYPOVJCSQHITR-UHFFFAOYSA-N |
| Boiling Point | 267 °C |
| Melting Point | 158-160 °C |
| Purity | 95% |
| Density | 1.48 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.002 |
| Isomeric SMILES | C1=CC2=C(C=C1O)OC(=O)S2 |
| pKa | 8.14±0.20 |
If you have any questions, please contact us. You will get a satisfactory answer.
