Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1298 |
| Product Name | Thymine |
| CAS | 65-71-4 |
| Structure |  |
| Synonyms | 2,4(1H,3H)-Pyrimidinedione, 5-methyl-;5-Methyluracil |
| IUPAC Name | 5-methyl-1H-pyrimidine-2,4-dione |
| Molecular Weight | 126.11 g/mol |
| Molecular Formula | C5H6N2O2 |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| InChI Key | RWQNBRDOKXIBIV-UHFFFAOYSA-N |
| Melting Point | 320 °C |
| Purity | 95% |
| Density | 1.35 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Isomeric SMILES | CC1=CNC(=O)NC1=O |
If you have any questions, please contact us. You will get a satisfactory answer.
