Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1282 |
| Product Name | Thiodipropionic Acid |
| CAS | 111-17-1 |
| Structure |  |
| Synonyms | 3,3'-Thiodipropionic acid |
| IUPAC Name | 3-(2-carboxyethylsulfanyl)propanoic acid |
| Molecular Weight | 178.21 g/mol |
| Molecular Formula | C6H10O4S |
| InChI | InChI=1S/C6H10O4S/c7-5(8)1-3-11-4-2-6(9)10/h1-4H2,(H,7,8)(H,9,10) |
| InChI Key | ODJQKYXPKWQWNK-UHFFFAOYSA-N |
| Boiling Point | 280.5 °C |
| Melting Point | 131-134 °C |
| Purity | 0.98 |
| Density | 1.24 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0102 |
| Isomeric SMILES | C(CSCCC(=O)O)C(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
