Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1304 |
| Product Name | Thiazolylalanine |
| CAS | 119433-80-6 |
| Structure |  |
| Synonyms | L-3-(4-Thiazolyl)-alanine |
| IUPAC Name | (2S)-2-amino-3-(1,3-thiazol-4-yl)propanoic acid |
| Molecular Weight | 172.21 g/mol |
| Molecular Formula | C6H8N2O2S |
| InChI | InChI=1S/C6H8N2O2S/c7-5(6(9)10)1-4-2-11-3-8-4/h2-3,5H,1,7H2,(H,9,10)/t5-/m0/s1 |
| InChI Key | WBZIGVCQRXJYQD-YFKPBYRVSA-N |
| Boiling Point | 353.3±32.0 °C |
| Purity | 95% |
| Density | 1.43 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=C(N=CS1)C[C@@H](C(=O)O)N |
| pKa | 8.24±0.16 |
If you have any questions, please contact us. You will get a satisfactory answer.
