Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0001 |
| Product Name | Theophylline |
| CAS | 58-55-9 |
| Structure |  |
| Synonyms | 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl- |
| IUPAC Name | 1,3-dimethyl-7H-purine-2,6-dione |
| Molecular Weight | 180.16 g/mol |
| Molecular Formula | C7H8N4O2 |
| InChI | InChI=1S/C7H8N4O2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13/h3H,1-2H3,(H,8,9) |
| InChI Key | ZFXYFBGIUFBOJW-UHFFFAOYSA-N |
| Boiling Point | 313 °C |
| Melting Point | 271-273 °C |
| Purity | 95% |
| Density | 1.36 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
If you have any questions, please contact us. You will get a satisfactory answer.
