Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0088 |
| Product Name | Tetrasodium EDTA |
| CAS | 64-02-8 |
| Structure |  |
| Synonyms | Acetic acid, (ethylenedinitrilo)tetra-, tetrasodium salt;Tetrasodium ethylenediaminetetraacetate;Tetrasodium edetate |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| Molecular Weight | 380.17 g/mol |
| Molecular Formula | C10H16N2O8Na4 |
| InChI | InChI=1S/C10H16N2O8.4Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;/q;4*+1/p-4 |
| InChI Key | UEUXEKPTXMALOB-UHFFFAOYSA-J |
| Melting Point | >300 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.02 |
| Highest Usage In Rinsing Products | 0.03 |
| Isomeric SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
Tetrasodium EDTA, a sodium salt of ethylenediaminetetraacetic acid, is extensively utilized as a chelating agent to counteract metal ions, including those with potentially harmful effects on skin health. Its four sodium-occupied carboxylic groups contribute to an alkaline pH of approximately 11, allowing it to also function as a pH balancer in acidic formulations. With its six active functional groups-comprising two amino and four carboxylic groups-Tetrasodium EDTA is capable of forming complexes with metal ions, thereby detoxifying the skin and enhancing the performance of antioxidants and other ingredients. Additionally, it softens hard water by sequestering calcium and magnesium ions, thus improving the efficacy of surfactants in cleansing products. Furthermore, Tetrasodium EDTA facilitates improved absorption and effectiveness of other ingredients, possesses antibacterial and anti-biofilm properties beneficial for wound healing and conditions like acne, and extends the shelf-life and preservative effectiveness of formulations. It also amplifies the antioxidant effects of vitamins such as E and C. Extensive clinical studies confirm its safety in personal care use, as the large molecular size and limited lipophilicity prevent absorption through the skin.
What is Tetrasodium EDTA, and how does it function in personal care products?
Tetrasodium EDTA is a sodium salt of ethylenediaminetetraacetic acid, recognized for its ability to chelate or bind metal ions. With its six active functional groups, it forms complexes with various metal ions, including heavy metals. This chelating action detoxifies the skin, supports antioxidant efficacy, and protects other formulation ingredients. Additionally, it acts as a pH balancer in acidic formulations due to its alkaline nature and improves the effectiveness of surfactants by softening hard water.
What are the benefits of using Tetrasodium EDTA in skincare products?
Tetrasodium EDTA offers multiple benefits in skincare products. It detoxifies the skin by binding harmful metal ions, enhances the performance of antioxidants like vitamins E and C, and helps maintain a balanced pH in products. It also improves the penetration and adsorption of other active ingredients, enhances preservative efficacy, and exhibits antibacterial and anti-biofilm properties beneficial in treating acne and supporting wound healing.
Is Tetrasodium EDTA safe for use in personal care formulations?
Yes, Tetrasodium EDTA is considered safe for use in personal care formulations. Multiple clinical studies have demonstrated that EDTA and its salts are not absorbed through the skin due to their large molecular size and limited lipophilicity. The Cosmetic Ingredient Review Expert Panel includes Tetrasodium EDTA on their list of safe ingredients for personal care applications.
How does Tetrasodium EDTA interact with other ingredients in personal care products?
Tetrasodium EDTA can enhance the penetration and effectiveness of other ingredients by increasing their adsorption levels. This interaction improves the overall performance of the product. Additionally, Tetrasodium EDTA's ability to form complexes with metal ions boosts preservative efficiency and extends the product's shelf life, ensuring its efficacy over time.
Can Tetrasodium EDTA improve the efficacy of surfactants in cleansing products?
Yes, Tetrasodium EDTA can enhance the efficacy of surfactants in cleansing products. By capturing Ca2+ and Mg2+ ions in hard water, it softens the water, allowing surfactants to perform optimally. This results in more effective cleansing and improved product performance.
If you have any questions, please contact us. You will get a satisfactory answer.
