Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0080 |
| Product Name | Tetrapeptide-21 |
| CAS | 960608-17-7 |
| Synonyms | Glycine, glycyl-L-α-glutamyl-L-lysyl- |
| IUPAC Name | (4S)-4-[(2-aminoacetyl)amino]-5-[[(2S)-6-amino-1-(carboxymethylamino)-1-oxohexan-2-yl]amino]-5-oxopentanoic acid |
| Molecular Weight | 389.4 g/mol |
| Molecular Formula | C15H27N5O7 |
| InChI | InChI=1S/C15H27N5O7/c16-6-2-1-3-9(14(26)18-8-13(24)25)20-15(27)10(4-5-12(22)23)19-11(21)7-17/h9-10H,1-8,16-17H2,(H,18,26)(H,19,21)(H,20,27)(H,22,23)(H,24,25)/t9-,10-/m0/s1 |
| InChI Key | CUVSTAMIHSSVKL-UWVGGRQHSA-N |
| Boiling Point | 896.1±65.0 °C |
| Purity | 0.95 |
| Density | 1.336 g/mL |
| Appearance | White powder |
| Storage | -15~-20 °C |
| Isomeric SMILES | C(CCN)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CN |
| pKa | 3.29±0.10 |
| Safety | No heavy metals, no skin and eye irritation |
What is the chemical formula for Tetrapeptide-21?
The chemical formula for Tetrapeptide-21 is C15H27N5O7.
What is the molecular weight of Tetrapeptide-21?
The molecular weight of Tetrapeptide-21 is 389.4 g/mol.
What are some synonyms for Tetrapeptide-21?
Some synonyms for Tetrapeptide-21 include Glycine, glycyl-L-α-glutamyl-L-lysyl- and Tetrapeptide-21.
What is the boiling point of Tetrapeptide-21?
The predicted boiling point of Tetrapeptide-21 is 896.1±65.0 °C.
What is the density of Tetrapeptide-21?
The predicted density of Tetrapeptide-21 is 1.336±0.06 g/cm3.
How does Tetrapeptide-21 promote skin health?
Tetrapeptide-21 promotes the synthesis of extracellular matrix, reducing wrinkles and improving skin aging.
How does Tetrapeptide-21 compare to other peptides like Matrixyl?
Tetrapeptide-21 is said to have a more prominent effect compared to other peptides like Matrixyl.
What are some uses of Tetrapeptide-21 in skincare products?
Tetrapeptide-21 is used to dilute wrinkles, improve skin firmness, smoothness, and elasticity in anti-wrinkle and anti-aging care products.
What is the pKa value of Tetrapeptide-21?
The predicted pKa value of Tetrapeptide-21 is 3.29±0.10.
If you have any questions, please contact us. You will get a satisfactory answer.
