Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0097 |
| Product Name | Tetrahydroxypropyl Ethylenediamine |
| CAS | 102-60-3 |
| Structure |  |
| Synonyms | N,N,N',N'-Tetrakis(2-hydroxypropyl)ethylenediamine |
| IUPAC Name | 1-[2-[bis(2-hydroxypropyl)amino]ethyl-(2-hydroxypropyl)amino]propan-2-ol |
| Molecular Weight | 292.41 g/mol |
| Molecular Formula | C14H32N2O4 |
| InChI | InChI=1S/C14H32N2O4/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20/h11-14,17-20H,5-10H2,1-4H3 |
| InChI Key | NSOXQYCFHDMMGV-UHFFFAOYSA-N |
| Melting Point | 32 °C |
| Purity | 95% |
| Density | 1.03 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0325 |
| Isomeric SMILES | CC(CN(CCN(CC(C)O)CC(C)O)CC(C)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
