Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1266 |
| Product Name | Tetrahydropiperine |
| CAS | 23434-88-0 |
| Structure |  |
| Synonyms | 1-Pentanone, 5-(1,3-benzodioxol-5-yl)-1-(1-piperidinyl)- |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpentan-1-one |
| Molecular Weight | 289.37 g/mol |
| Molecular Formula | C5H5N5 |
| InChI | InChI=1S/C17H23NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h8-9,12H,1-7,10-11,13H2 |
| InChI Key | APZYKUZPJCQGPP-UHFFFAOYSA-N |
| Boiling Point | 261 °C |
| Purity | 95% |
| Density | 1.16 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | C1CCN(CC1)C(=O)CCCCC2=CC3=C(C=C2)OCO3 |
If you have any questions, please contact us. You will get a satisfactory answer.
